
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1600-19-7 |
| Catalog No. | 2A-9027106 |
| Chinese Name | 双甲苯醚甲胺 |
| Synonyms | Xyloxeminum; UNII-L95KV83PV9; Xiloxemina; Xyloxemine |
| Molecular Formula | C23H33NO2 |
| Molecular Weight | 355.51400 |
| Purity | 98.00 |
| Density | 1.005g/cm3 |
| Boiling Point | 458.8ºC at 760mmHg |
| HTC | 2922199090 |
| PubChem ID | 8163335 |
| SMILES | Cc1cccc(C)c1C(OCCOCCN(C)C)c1c(C)cccc1C |
| InChI | InChI=1S/C23H33NO2/c1-17-9-7-10-18(2)21(17)23(22-19(3)11-8-12-20(22)4)26-16-15-25-14-13-24(5)6/h7-12,23H,13-16H2,1-6H3 |
| InChI Key | KLOZENAJUCRQKD-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-Iodobiphenyl | 1591-31-7 | 2A-9027094 |
| 4-Vinylbenzyl chloride | 1592-20-7 | 2A-9027095 |
| Calcium stearate | 1592-23-0 | 2A-9027096 |
| L-(-)-Histidinol dihydrochloride | 1596-64-1 | 2A-9027100 |
| Daminozide | 1596-84-5 | 2A-9027101 |
| 2,5,6-Triaminopyrimidin-4-ol sulphate | 1603-02-7 | 2A-9027108 |
| 2-Amino-3-picoline | 1603-40-3 | 2A-9027109 |
| 1-Aminopyrene | 1606-67-3 | 2A-9027113 |
| 5-Oxa-2-octyne-1,7-diol | 1606-79-7 | 2A-9027114 |
| 1,4-Bis(2-hydroxyethoxy)-2-butyne | 1606-85-5 | 2A-9027115 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA