
CAS Number1538-09-6
Synonymsleomypen; neolin; dibencil; benzathine benzylpenicillin; benzapen; moldamin; N,N'-Dibenzylethylenedi amine bis[benzylpenicillin]; Megacillin; pendepon; DBED-penicillin; Penicillin G N,N'-dibenzylethylenediamine salt; cillenta; penadur; Benzathine Penicillin G; bicillin; longicil
Molecular FormulaC48H56N6O8S2
Molecular Weight909.14
Purity98.00%
Boiling Point663.3ºCat 760 mmHg
Melting Point123-124ºC
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1538-09-6 |
| Catalog No. | 2A-9027002 |
| Chinese Name | 苄星青霉素 |
| Synonyms | leomypen; neolin; dibencil; benzathine benzylpenicillin; benzapen; moldamin; N,N'-Dibenzylethylenedi amine bis[benzylpenicillin]; Megacillin; pendepon; DBED-penicillin; Penicillin G N,N'-dibenzylethylenediamine salt; cillenta; penadur; Benzathine Penicillin G; bicillin; longicil |
| Molecular Formula | C48H56N6O8S2 |
| Molecular Weight | 909.14 |
| Purity | 98.00 |
| Boiling Point | 663.3ºCat 760 mmHg |
| Melting Point | 123-124ºC |
| Storage Condition | Ventilated and low temperature drying |
| Application | Penicillin G benzathine (Benzathine benzylpenicillin) is an antibiotic that fights a variety of bacterial infections. |
| PubChem ID | 8161430 |
| MDL Number | C48H56N6O8S2 |
| SMILES | CC1(C)SC2C(NC(=O)Cc3ccccc3)C(=O)N2C1C(=O)O.CC1(C)SC2C(NC(=O)Cc3ccccc3)C(=O)N2C1C(=O)O.c1ccc(CNCCNCc2ccccc2)cc1 |
| InChI | InChI=1S/2C16H18N2O4S.C16H20N2/c2*1-16(2)12(15(21)22)18-13(20)11(14(18)23-16)17-10(19)8-9-6-4-3-5-7-9;1-3-7-15(8-4-1)13-17-11-12-18-14-16-9-5-2-6-10-16/h2*3-7,11-12,14H,8H2,1-2H3,(H,17,19)(H,21,22);1-10,17-18H,11-14H2/t2*11-,12+,14-;/m11./s1 |
| InChI Key | BVGLIYRKPOITBQ-ANPZCEIESA-N |
| MSDS | msds/27002_1_1538_09_6.pdf |
| Transport Info | Product name: Penicillin G benzathine salt |
| Related Products in API & Advanced Intermediates | ||
|---|---|---|
| Gentamicin | 1403-66-3 | 2A-9026754 |
| Vancomycin | 1404-90-6 | 2A-9026755 |
| Polymyxin B sulfate | 1405-20-5 | 2A-9026758 |
| Dihydrostreptomycin sulfate | 1425-61-2 | 2A-9026784 |
| NORVERAPAMIL HYDROCHLORIDE | 67812-42-4 | 2A-9026923 |
| Prednisolone sodium succinate | 1715-33-9 | 2A-9027343 |
| 17beta-Estradiol 17-acetate | 1743-60-8 | 2A-9027401 |
| Estriol-16beta-D-glucopyranosiduronic acid | 1852-50-2 | 2A-9027582 |
| Dexamethasone 21-(sodium hydrogen phosphate) | 1869-92-7 | 2A-9027602 |
| 2-Hydroxy-6-mercaptopurine | 2002-59-7 | 2A-9027791 |
| Browse all API & Advanced Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA