
CAS Number1531-78-8
Synonymsethyl o-chloromethylbenzoate; Benzoic acid, 2-(chloromethyl)-, ethyl ester; 2-chloromethyl-benzoic acid ethyl ester; Ethyl 2-(chloromethyl)benzoate; Ethyl 2-chloromethylbenzoate
Molecular FormulaC10H11ClO2
Molecular Weight198.646
Purity98.00%
Density1.2±0.1 g/cm3
Boiling Point297.1±23.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1531-78-8 |
| Catalog No. | 2A-9026988 |
| Chinese Name | 2-氯甲基苯甲酸乙酯 |
| Synonyms | ethyl o-chloromethylbenzoate; Benzoic acid, 2-(chloromethyl)-, ethyl ester; 2-chloromethyl-benzoic acid ethyl ester; Ethyl 2-(chloromethyl)benzoate; Ethyl 2-chloromethylbenzoate |
| Molecular Formula | C10H11ClO2 |
| Molecular Weight | 198.646 |
| Purity | 98.00 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 297.1±23.0 °C at 760 mmHg |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2916399090 |
| PubChem ID | 30394479 |
| SMILES | CCOC(=O)c1ccccc1CCl |
| InChI | InChI=1S/C10H11ClO2/c1-2-13-10(12)9-6-4-3-5-8(9)7-11/h3-6H,2,7H2,1H3 |
| InChI Key | QQOVRPBUAUNBAV-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| trans-DL-1,2-Cyclopentanedicarboxylic acid | 1461-97-8 | 2A-9026856 |
| N-Methylbenzohydrazide | 1483-24-5 | 2A-9026906 |
| Diphenyliodonium-2-carboxylate | 1488-42-2 | 2A-9026916 |
| Cyclopropanecarboxaldehyde | 1489-69-6 | 2A-9026919 |
| Ethyl 4,4,4-trifluoro-3-(trifluoromethyl)crotonate | 1513-60-6 | 2A-9026951 |
| Difluoromethyl phenyl sulfone | 1535-65-5 | 2A-9026998 |
| 2,2,2-Trifluoroacetohydrazide | 1538-08-5 | 2A-9027001 |
| Trichloro(dichloromethyl)silane | 1558-24-3 | 2A-9027027 |
| Chloromethyldichloromethylsilane | 1558-33-4 | 2A-0201954 |
| Ethyl 1-cyanocyclopropanecarboxylate | 1558-81-2 | 2A-9027030 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA