
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1513-60-6 |
| Catalog No. | 2A-9026951 |
| Chinese Name | 4,4,4-三氟-3-三氟甲基丁酸乙酯 |
| Synonyms | MFCD00041517; PC3289G; 4,4,4-Trifluor-3-trifluormethylcrotonsaeure-ethylester; ethyl 4,4,4-trifluoro-3-trifluoromethyl-2-butenoate |
| Molecular Formula | C7H9O2N1F6 |
| Molecular Weight | 253.14 |
| Purity | 98.00 |
| Density | >1.1 |
| Boiling Point | 128 °C |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2916190090 |
| PubChem ID | 3160845 |
| MDL Number | MFCD00040845 |
| SMILES | CCOC(=O)C=C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H6F6O2/c1-2-15-5(14)3-4(6(8,9)10)7(11,12)13/h3H,2H2,1H3 |
| InChI Key | CULZFNOUPBWSIZ-UHFFFAOYSA-N |
| MSDS | msds/26951_1_1513_60_6.pdf |
| Tax Rebate | 9.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Imported food hygiene supervision and inspection S. Export food hygiene supervision and inspection M. Imported commodity inspection N. Exported commodity inspection |
| Transport Info | Product name: Supervision conditions A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| Chlorotributyltin | 1461-22-9 | 2A-9026854 |
| trans-DL-1,2-Cyclopentanedicarboxylic acid | 1461-97-8 | 2A-9026856 |
| N-Methylbenzohydrazide | 1483-24-5 | 2A-9026906 |
| Diphenyliodonium-2-carboxylate | 1488-42-2 | 2A-9026916 |
| Cyclopropanecarboxaldehyde | 1489-69-6 | 2A-9026919 |
| Ethyl 2-chloromethylbenzoate | 1531-78-8 | 2A-9026988 |
| Difluoromethyl phenyl sulfone | 1535-65-5 | 2A-9026998 |
| 2,2,2-Trifluoroacetohydrazide | 1538-08-5 | 2A-9027001 |
| Trichloro(dichloromethyl)silane | 1558-24-3 | 2A-9027027 |
| Chloromethyldichloromethylsilane | 1558-33-4 | 2A-0201954 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA