
CAS Number1522-34-5
SynonymsValeric acid,2-acetyl-4-methyl-,ethyl ester; Valeric acid, 2-acetyl-4-methyl-, ethyl ester; Ethyl 2-isobutylacetoacetate; 2-isobutyl-acetoacetic acid ethyl ester; Ethyl 2-acetyl-4-methylpentanoate; 2-Isobutyl-acetessigsaeure-aethylester; Pentanoic acid, 2-acetyl-4-methyl-, ethyl ester; Ethyl, 2-isobutyl acetoacetate; 2-acetyl-4-methylpentanoic acid ethyl ester; ethyl 2-isobutyl-3-oxobutanoate
Molecular FormulaC10H18O3
Molecular Weight186.25
Purity98.00%
Density1.0±0.1 g/cm3
Boiling Point221.2±8.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1522-34-5 |
| Catalog No. | 2A-9026971 |
| Chinese Name | 2-异丁基乙酰乙酸乙酯 |
| Synonyms | Valeric acid,2-acetyl-4-methyl-,ethyl ester; Valeric acid, 2-acetyl-4-methyl-, ethyl ester; Ethyl 2-isobutylacetoacetate; 2-isobutyl-acetoacetic acid ethyl ester; Ethyl 2-acetyl-4-methylpentanoate; 2-Isobutyl-acetessigsaeure-aethylester; Pentanoic acid, 2-acetyl-4-methyl-, ethyl ester; Ethyl, 2-isobutyl acetoacetate; 2-acetyl-4-methylpentanoic acid ethyl ester; ethyl 2-isobutyl-3-oxobutanoate |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 |
| Purity | 98.00 |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 221.2±8.0 °C at 760 mmHg |
| Storage Condition | room temperature |
| HTC | 2918300090 |
| PubChem ID | 8675479 |
| MDL Number | MFCD00457371 |
| SMILES | CCOC(=O)C(CC(C)C)C(C)=O |
| InChI | InChI=1S/C10H18O3/c1-5-13-10(12)9(8(4)11)6-7(2)3/h7,9H,5-6H2,1-4H3 |
| InChI Key | ZGULNKYAODXSCS-UHFFFAOYSA-N |
| MSDS | msds/26971_1_1522_34_5.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-Methylbenzhydrol | 1517-63-1 | 2A-9026961 |
| 7,7,8,8-Tetracyanoquinodimethane | 1518-16-7 | 2A-9026963 |
| Diisobutyl disulfide | 1518-72-5 | 2A-9026964 |
| Ethanesulfonamide | 1520-70-3 | 2A-9026966 |
| 3-Bromocyclohexene | 1521-51-3 | 2A-9026968 |
| Ethyl 2-fluoroacetoacetate | 1522-41-4 | 2A-9026972 |
| Ethyl 2-isopropylacetoacetate | 1522-46-9 | 2A-9026973 |
| 2-Naphthyl acetate | 1523-11-1 | 2A-9026975 |
| 9-Fluoro-16a,17-(isopropylidenedioxy)corticosterone | 1524-86-3 | 2A-9026976 |
| Flurandrenolide | 1524-88-5 | 2A-9026977 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA