
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1517-63-1 |
| Catalog No. | 2A-9026961 |
| Chinese Name | 4-甲基二苯基甲醇 |
| Synonyms | EINECS 216-171-1; MFCD00004492; 4-Methyldiphenylmethanol; (4-methylphenyl)-phenylmethanol; Phenyl(p-tolyl)methanol |
| Molecular Formula | C14H14O |
| Molecular Weight | 198.26 |
| Purity | 98.00 |
| Density | 1.081 g/cm3 |
| Melting Point | 50-54 °C(lit.) |
| Appearance | white crystal |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2902909090 |
| PubChem ID | 71457 |
| SMILES | Cc1ccc(C(O)c2ccccc2)cc1 |
| InChI | InChI=1S/C14H14O/c1-11-7-9-13(10-8-11)14(15)12-5-3-2-4-6-12/h2-10,14-15H,1H3 |
| InChI Key | IHASOVONMUHDND-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None. MFN tariff: 2.0%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-(Trifluoromethoxy)benzenesulfonamide | 1513-45-7 | 2A-9026950 |
| N-Butylphthalimide | 1515-72-6 | 2A-9026957 |
| trans,trans-2,4-Hexadienyl acetate | 1516-17-2 | 2A-9026958 |
| (2-Methoxyphenyl)thiourea | 1516-37-6 | 2A-9026959 |
| 4-Bromo-2,6-di-tert-butylanisole | 1516-96-7 | 2A-9026960 |
| 7,7,8,8-Tetracyanoquinodimethane | 1518-16-7 | 2A-9026963 |
| Diisobutyl disulfide | 1518-72-5 | 2A-9026964 |
| Ethanesulfonamide | 1520-70-3 | 2A-9026966 |
| 3-Bromocyclohexene | 1521-51-3 | 2A-9026968 |
| Ethyl 2-isobutylacetoacetate | 1522-34-5 | 2A-9026971 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA