
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1391-36-2 |
| Catalog No. | 2A-9026745 |
| Chinese Name | 兰考韦泰 |
| Synonyms | UNII-BPR0F3X56H; Lancovutide [INN]; Leucopeptin; LANCOVUTIDE |
| Molecular Formula | C89H125N23O25S3 |
| Molecular Weight | 1999.25000 |
| Purity | 98.00 |
| Density | 1.0238 (rough estimate) |
| Melting Point | 271-273ºC |
| Water Solubility | 0.1 M HCl: soluble10mg/mL |
| Storage Condition | 2-8°C |
| Application | Duramycin (Moli1901; Lancovutide) is a cyclic peptide lantibiotic derived from Streptomyces cinnamomi. Duramycin stimulates chloride secretion in the airway epithelium and has been used in cystic fibr |
| PubChem ID | 96099904 |
| SMILES | CC(C)C1NC(=O)C(Cc2ccccc2)NC(=O)C2NC(=O)C(Cc3ccccc3)NC(=O)C3CCCN3C(=O)CNC(=O)C(Cc3ccccc3)NC(=O)C3CNCCCCC(C(=O)O)NC(=O)C4CSCC(N)C(=O)NC(CCCCN)C(=O)NC(CCC(N)=O)C(=O)NC(CSCC(NC1=O)C(=O)NC(C(O)C(=O)O)C(=O)NCC(=O)NC(CC(N)=O)C(=O)N4)C(=O)NC(CSC2C)C(=O)N3 |
| InChI | InChI=1S/C89H125N23O25S3/c1-44(2)67-85(131)107-60-42-138-41-59-80(126)106-61-43-140-46(4)69(87(133)103-56(76(122)108-67)35-49-23-12-7-13-24-49)109-77(123)55(34-48-21-10-6-11-22-48)102-83(129)62-27-18-32-112(62)66(116)39-96-73(119)54(33-47-19-8-5-9-20-47)101-79(125)58(104-81(61)127)37-94-31-17-15-26-53(88(134)135)100-86(132)68(110-78(124)57(36-64(93)114)97-65(115)38-95-84(130)70(111-82(60)128)71(117)89(136)137)45(3)139-40-50(91)72(118)98-51(25-14-16-30-90)74(120)99-52(75(121)105-59)28-29-63(92)113/h5-13,19-24,44-46,50-62,67-71,94,117H,14-18,25-43,90-91H2,1-4H3,(H2,92,113)(H2,93,114)(H,95,130)(H,96,119)(H,97,115)(H,98,118)(H,99,120)(H,100,132)(H,101,125)(H,102,129)(H,103,133)(H,104,127)(H,105,121)(H,106,126)(H,107,131)(H,108,122)(H,109,123)(H,110,124)(H,111,128)(H,134,135)(H,136,137)/t45-,46-,50-,51-,52-,53-,54-,55-,56-,57-,58-,59+,60-,61-,62-,67-,68+,69+,70-,71+/m0/s1 |
| InChI Key | BPIFGBWRBGTMHX-CREJVHTASA-N |
| Transport Info | Product name: Lankao Weitai |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Magnesium silicate | 1343-88-0 | 2A-9026733 |
| Silicic acid | 1343-98-2 | 2A-9026734 |
| Sodium polysulfide | 1344-08-7 | 2A-9026735 |
| Copper sulfate basic | 1344-73-6 | 2A-9026740 |
| cerium oxide | 1345-13-7 | 2A-9026742 |
| Kitasamycin | 1392-21-8 | 2A-9026746 |
| Chitin | 1398-61-4 | 2A-9026749 |
| Orcein | 1400-62-0 | 2A-9026751 |
| Capastat sulfate | 1405-37-4 | 2A-9026759 |
| Gentamycin sulfate | 1405-41-0 | 2A-9026760 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA