CAS Number1215-59-4
Synonyms5-Benzyloxyindole; 5-(Benzyloxy)indole; 5-Benzyindole; 5-benzyloxy-indol; Benzyloxy-5 indole; 5-phenylmethoxyindole; bredreck's; EINECS 214-930-1; 5-(Benzyloxy)-1H-indole; 5-phenylmethoxy-1H-indole; 5-BnO-indole; 5-BENZYLOXY-1H-INDOLE; MFCD00005676
Molecular FormulaC15H13NO
Molecular Weight223.27
Purity95%
Density1.2±0.1 g/cm3
Boiling Point411.6±20.0 °C at 760 mmHg
Melting Point100-104 °C (lit.)
Appearancepowder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1215-59-4 |
| Catalog No. | 2A-9026515 |
| Chinese Name | 5-苄氧基吲哚 |
| Synonyms | 5-Benzyloxyindole; 5-(Benzyloxy)indole; 5-Benzyindole; 5-benzyloxy-indol; Benzyloxy-5 indole; 5-phenylmethoxyindole; bredreck's; EINECS 214-930-1; 5-(Benzyloxy)-1H-indole; 5-phenylmethoxy-1H-indole; 5-BnO-indole; 5-BENZYLOXY-1H-INDOLE; MFCD00005676 |
| Molecular Formula | C15H13NO |
| Molecular Weight | 223.27 |
| Purity | 95 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 411.6±20.0 °C at 760 mmHg |
| Melting Point | 100-104 °C (lit.) |
| Appearance | powder |
| Water Solubility | ethanol: may be hazy yellow |
| Storage Condition | Sealed, store at 2 ºC -8 ºC |
| HTC | 2933990090 |
| PubChem ID | 24891673 |
| MDL Number | MFCD00005676 |
| SMILES | C(Oc1ccc2[nH]ccc2c1)c3ccccc3 |
| InChI | 1S/C15H13NO/c1-2-4-12(5-3-1)11-17-14-6-7-15-13(10-14)8-9-16-15/h1-10,16H,11H2 |
| InChI Key | JCQLPDZCNSVBMS-UHFFFAOYSA-N |
| Beilstein/REAXYS | 173532 |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| MSDS | msds/26515_1_1215_59_4.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 5-Methyl-1H-indazole-3-carboxylic acid | 1201-24-7 | 2A-9026478 |
| 3-(Chloromethyl)-5-phenyl-1,2,4-oxadiazole | 1201-68-9 | 2A-9026482 |
| 4-Amino-1-benzylpiperidine dihydrochloride hydrate | 1205-72-7 | 2A-9026498 |
| 4,6-Dimethyldibenzothiophene | 1207-12-1 | 2A-9026503 |
| 2-(4-Chlorophenyl)-1H-indole | 1211-35-4 | 2A-9026510 |
| 1-DODECYL-PYRROLE-2,5-DIONE | 17616-03-4 | 2A-9026593 |
| 2-(4-CHLOROPHENYL)-1,3-THIAZOLE-4-CARBOXYLIC ACID | 17228-98-7 | 2A-9026602 |
| 3-HYDROXY-5-PHENYLPYRROLE | 100750-40-1 | 2A-9026621 |
| 4,5-DICHLOROTHIOPHENE-2-CARBOXYLIC ACID | 31166-29-7 | 2A-9026632 |
| 3,5-DIAMINOPYRIDINE | 4318-78-9 | 2A-9026718 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS