
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1211-35-4 |
| Catalog No. | 2A-9026510 |
| Chinese Name | 2-(4-氯苯基)-1H-吲哚 |
| Synonyms | 2-(4-Chlorophenyl)indole; MFCD00047159 |
| Molecular Formula | C14H10ClN |
| Molecular Weight | 227.69 |
| Purity | 98.00 |
| Density | 1.271g/cm3 |
| Boiling Point | 417.8ºC at 760mmHg |
| Melting Point | 203 °C |
| Appearance | solid |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2933990090 |
| PubChem ID | 329788316 |
| MDL Number | MFCD00047159 |
| SMILES | Clc1ccc(cc1)-c2cc3ccccc3[nH]2 |
| InChI | 1S/C14H10ClN/c15-12-7-5-10(6-8-12)14-9-11-3-1-2-4-13(11)16-14/h1-9,16H |
| InChI Key | KDNXKQSAAZNUCK-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352200 |
| MSDS | msds/26510_1_1211_35_4.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 8-Bromo-4-chloro-2-methylquinoline | 1201-07-6 | 2A-9026477 |
| 5-Methyl-1H-indazole-3-carboxylic acid | 1201-24-7 | 2A-9026478 |
| 3-(Chloromethyl)-5-phenyl-1,2,4-oxadiazole | 1201-68-9 | 2A-9026482 |
| 4-Amino-1-benzylpiperidine dihydrochloride hydrate | 1205-72-7 | 2A-9026498 |
| 4,6-Dimethyldibenzothiophene | 1207-12-1 | 2A-9026503 |
| 5-Benzyloxyindole | 1215-59-4 | 2A-9026515 |
| 1-DODECYL-PYRROLE-2,5-DIONE | 17616-03-4 | 2A-9026593 |
| 2-(4-CHLOROPHENYL)-1,3-THIAZOLE-4-CARBOXYLIC ACID | 17228-98-7 | 2A-9026602 |
| 3-HYDROXY-5-PHENYLPYRROLE | 100750-40-1 | 2A-9026621 |
| 4,5-DICHLOROTHIOPHENE-2-CARBOXYLIC ACID | 31166-29-7 | 2A-9026632 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA