
CAS Number1210-35-1
Synonyms5,6-dihydrodibenzo[2,1-b:2',1'-f][7]annulen-11-one; 10,11-Dihydro-5H-dibenzo[a,d][7]annulen-5-one; Dibenzosuberone; EINECS 214-912-3; L C676 BV&T&J; MFCD00003587
Molecular FormulaC15H12O
Molecular Weight208.26
Purity98.00%
Density1.2±0.1 g/cm3
Boiling Point378.3±0.0 °C at 760 mmHg
Melting Point32-34 °C(lit.)
AppearanceTransparent to yellow liquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1210-35-1 |
| Catalog No. | 2A-9026509 |
| Chinese Name | 二苯并环庚酮 |
| Synonyms | 5,6-dihydrodibenzo[2,1-b:2',1'-f][7]annulen-11-one; 10,11-Dihydro-5H-dibenzo[a,d][7]annulen-5-one; Dibenzosuberone; EINECS 214-912-3; L C676 BV&T&J; MFCD00003587 |
| Molecular Formula | C15H12O |
| Molecular Weight | 208.26 |
| Purity | 98.00 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 378.3±0.0 °C at 760 mmHg |
| Melting Point | 32-34 °C(lit.) |
| Appearance | Transparent to yellow liquid |
| Water Solubility | insoluble |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 29143900 |
| PubChem ID | 329749006 |
| SMILES | O=C1c2ccccc2CCc2ccccc21 |
| InChI | InChI=1S/C15H12O/c16-15-13-7-3-1-5-11(13)9-10-12-6-2-4-8-14(12)15/h1-8H,9-10H2 |
| InChI Key | BMVWCPGVLSILMU-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 5.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2914399090. other aromatic ketones without other oxygen function. VAT:17.0%. Tax rebate rate:13.0%. MFN tariff:5.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 9-Chloroacridine | 1207-69-8 | 2A-9026504 |
| 1-Benzylhexahydro-4-azepinone | 1208-75-9 | 2A-9026505 |
| 4-Methoxydiphenylamine | 1208-86-2 | 2A-9026506 |
| 9-Anthrracenecarbonitrile | 1210-12-4 | 2A-9026507 |
| 5-Chlorodibenzosuberane | 1210-33-9 | 2A-9026508 |
| 1,3-Dicyclohexylthiourea | 1212-29-9 | 2A-9026511 |
| 4-Chloro-N-(pyridin-2-yl)benzenesulfonamide | 1213-38-3 | 2A-9026512 |
| 2-(2-Hydroxyphenyl)-4H-benzo[e][1,3]oxazin-4-one | 1218-69-5 | 2A-9026520 |
| Octyl paraben | 1219-38-1 | 2A-9026521 |
| 2,2-Bis(3-amino-4-hydroxyphenyl)propane | 1220-78-6 | 2A-9026522 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA