
CAS Number1208-86-2
Synonyms(4-Methoxy-phenyl)-phenyl-amine; 4-Methoxydiphenylamine; 4-Methoxy-N-phenylaniline; 4-METHOXY-N-PHENYLBENZENAMINE; EINECS 214-902-9
Molecular FormulaC13H13NO
Molecular Weight199.25
Purity98.00%
Density1.1±0.1 g/cm3
Boiling Point335.8±25.0 °C at 760 mmHg
Melting Point104.0 to 108.0 °C
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1208-86-2 |
| Catalog No. | 2A-9026506 |
| Chinese Name | 4-甲氧基二苯胺 |
| Synonyms | (4-Methoxy-phenyl)-phenyl-amine; 4-Methoxydiphenylamine; 4-Methoxy-N-phenylaniline; 4-METHOXY-N-PHENYLBENZENAMINE; EINECS 214-902-9 |
| Molecular Formula | C13H13NO |
| Molecular Weight | 199.25 |
| Purity | 98.00 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 335.8±25.0 °C at 760 mmHg |
| Melting Point | 104.0 to 108.0 °C |
| Storage Condition | room temperature |
| HTC | 2922299090 |
| PubChem ID | 90444 |
| SMILES | COc1ccc(Nc2ccccc2)cc1 |
| InChI | InChI=1S/C13H13NO/c1-15-13-9-7-12(8-10-13)14-11-5-3-2-4-6-11/h2-10,14H,1H3 |
| InChI Key | OBHGSIGHEBGGFS-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified 4-Methoxydiphenylamine Modification number: 5 |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-Bromo-3-oxo-N-phenylbutanamide | 1205-74-9 | 2A-9026499 |
| 1,4-Diacetoxybenzene | 1205-91-0 | 2A-9026500 |
| 2,3,4,5,6,7,8,9-Octahydro-1H-trindene | 1206-79-7 | 2A-9026502 |
| 9-Chloroacridine | 1207-69-8 | 2A-9026504 |
| 1-Benzylhexahydro-4-azepinone | 1208-75-9 | 2A-9026505 |
| 9-Anthrracenecarbonitrile | 1210-12-4 | 2A-9026507 |
| 5-Chlorodibenzosuberane | 1210-33-9 | 2A-9026508 |
| Dibenzosuberone | 1210-35-1 | 2A-9026509 |
| 1,3-Dicyclohexylthiourea | 1212-29-9 | 2A-9026511 |
| 4-Chloro-N-(pyridin-2-yl)benzenesulfonamide | 1213-38-3 | 2A-9026512 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA