
CAS Number1187-03-7
SynonymsUrea,tetraethyl; MFCD00042881; N,N-diethylurea; TEU; N,N,N',N'-tetraethyl urea; EINECS 214-696-0; 1,1,3,3-tetraethyl urea; UREA,1,1,3,3-TETRAETHYL; tetraethylurea
Molecular FormulaC9H20O1N2
Molecular Weight172.27
Purity98.00%
Density0.907 g/mL at 20 °C(lit.)
Boiling Point211-213 °C(lit.)
Appearancecolorless transparent liquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1187-03-7 |
| Catalog No. | 2A-9026390 |
| Chinese Name | 四乙基脲 |
| Synonyms | Urea,tetraethyl; MFCD00042881; N,N-diethylurea; TEU; N,N,N',N'-tetraethyl urea; EINECS 214-696-0; 1,1,3,3-tetraethyl urea; UREA,1,1,3,3-TETRAETHYL; tetraethylurea |
| Molecular Formula | C9H20O1N2 |
| Molecular Weight | 172.27 |
| Purity | 98.00 |
| Density | 0.907 g/mL at 20 °C(lit.) |
| Boiling Point | 211-213 °C(lit.) |
| Appearance | colorless transparent liquid |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2924199090 |
| PubChem ID | 6497424 |
| MDL Number | MFCD00042881 |
| SMILES | CCN(CC)C(=O)N(CC)CC |
| InChI | InChI=1S/C9H20N2O/c1-5-10(6-2)9(12)11(7-3)8-4/h5-8H2,1-4H3 |
| InChI Key | UWHSPZZUAYSGTB-UHFFFAOYSA-N |
| MSDS | msds/26390_1_1187_03_7.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 99.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| N-Methyl methanesulfonamide | 1184-85-6 | 2A-9026385 |
| Tris(hydroxymethyl)aminomethane hydrochloride | 1185-53-1 | 2A-9026386 |
| Methyltrimethoxysilane | 1185-55-3 | 2A-9026387 |
| Ammonium ferric citrate | 1185-57-5 | 2A-9026388 |
| Tetraethylammonium acetate | 1185-59-7 | 2A-9026389 |
| Diaminomaleonitrile | 1187-42-4 | 2A-9026391 |
| N-Methylpropionamide | 1187-58-2 | 2A-9026392 |
| Diethyl acetonylsuccinate | 1187-74-2 | 2A-9026393 |
| S-Methyl-L-cysteine | 1187-84-4 | 2A-9026394 |
| DL-Aspartic acid hemimagnesium salt | 1187-91-3 | 2A-9026395 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA