
CAS Number1141-23-7
Synonyms5-amino-3-(4-chlorophenyl)-5-oxopentanoic acid; -(4-CHLOROPHENYL)GLUTARIMIDE; 3-(4-CHLOROPHENYL)GLUTARAMICACID; 3-(4-CHLOROPHENYL)GLUTARIMIDE; SS-(4-CHLOROPHENYL)GLUTARIMIDE; 4-carbamoyl-3-(4-chlorophenyl)butanoic acid; 5-Amino-3-(4-chlorophenyl)-5-oxopentanoicacid; Β-(4-Chlorophenyl)Glutarimide; 3-(4-Chlorophenyl)glutaramic acid; B-(4-CHLOROPHENYL) GLUTARIC ACID MONOAMIDE; 3-(4-CHLOROPHENYL)-GLUTARIC ACID MONOAMIDE; MFCD00190251; 3-(4-CHLOROPHENYL)GLUTARIC ACID
Molecular FormulaC11H12ClNO3
Molecular Weight241.67
Purity98.00%
Density1.343 g/cm3
Boiling Point494.9ºC at 760 mmHg
Melting Point168-170°C
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1141-23-7 |
| Catalog No. | 2A-9026318 |
| Chinese Name | 3-(4-氯苯基)戊二酸单酰胺 |
| Synonyms | 5-amino-3-(4-chlorophenyl)-5-oxopentanoic acid; -(4-CHLOROPHENYL)GLUTARIMIDE; 3-(4-CHLOROPHENYL)GLUTARAMICACID; 3-(4-CHLOROPHENYL)GLUTARIMIDE; SS-(4-CHLOROPHENYL)GLUTARIMIDE; 4-carbamoyl-3-(4-chlorophenyl)butanoic acid; 5-Amino-3-(4-chlorophenyl)-5-oxopentanoicacid; Β-(4-Chlorophenyl)Glutarimide; 3-(4-Chlorophenyl)glutaramic acid; B-(4-CHLOROPHENYL) GLUTARIC ACID MONOAMIDE; 3-(4-CHLOROPHENYL)-GLUTARIC ACID MONOAMIDE; MFCD00190251; 3-(4-CHLOROPHENYL)GLUTARIC ACID |
| Molecular Formula | C11H12ClNO3 |
| Molecular Weight | 241.67 |
| Purity | 98.00 |
| Density | 1.343 g/cm3 |
| Boiling Point | 494.9ºC at 760 mmHg |
| Melting Point | 168-170°C |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2924299090 |
| PubChem ID | 6912484 |
| SMILES | NC(=O)CC(CC(=O)O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H12ClNO3/c12-9-3-1-7(2-4-9)8(5-10(13)14)6-11(15)16/h1-4,8H,5-6H2,(H2,13,14)(H,15,16) |
| InChI Key | NLCJVRPOYTZTMS-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Isolongifolene | 1135-66-6 | 2A-9026307 |
| 3',4',5'-Trimethoxyacetophenone | 1136-86-3 | 2A-9026309 |
| 5-Methoxy-alpha-methyltryptamine | 1137-04-8 | 2A-9026310 |
| 4-Hydroxybenzophenone | 1137-42-4 | 2A-9026312 |
| 4-Bromo-2,6-di-tert-butylphenol | 1139-52-2 | 2A-9026315 |
| Bis(4-chlorophenyl)disulfide | 1142-19-4 | 2A-9026321 |
| 5H-Dibenz[b,e]azepine-6,11-dione | 1143-50-6 | 2A-9026325 |
| 2,3,4-Trihydroxybenzophenone | 1143-72-2 | 2A-9026326 |
| 2-Phenylquinolin-4-ol | 1144-20-3 | 2A-9026328 |
| 4-Nitrobenzophenone | 1144-74-7 | 2A-9026329 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA