
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1129-46-0 |
| Catalog No. | 2A-9026280 |
| Chinese Name | (R)-2-苯氧基丙酸 |
| Synonyms | MFCD04038077 |
| Molecular Formula | C9H10O3 |
| Molecular Weight | 166.18 |
| Purity | 98.00 |
| Density | 1.174 g/cm3 |
| Boiling Point | 265ºC at 760 mmHg |
| Storage Condition | Room temperature, dry, sealed |
| HTC | 2918990090 |
| PubChem ID | 840250 |
| SMILES | CC(Oc1ccccc1)C(=O)O |
| InChI | InChI=1S/C9H10O3/c1-7(9(10)11)12-8-5-3-2-4-6-8/h2-7H,1H3,(H,10,11)/t7-/m1/s1 |
| InChI Key | SXERGJJQSKIUIC-SSDOTTSWSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Pharmaceutical Intermediates | ||
|---|---|---|
| (R)-2-Aminocyclohenanol | 931-16-8 | 2A-9025661 |
| 5-Methylimidazo[1,2-a]pyridine | 933-69-7 | 2A-9025687 |
| (R)-(-)-1-Methyl-3-phenylpropylamine | 937-52-0 | 2A-9025716 |
| Sulfaquinoxaline sodium | 967-80-6 | 2A-9025797 |
| (2R,3S)-2-Amino-3-methylsuccinic acid | 1114-07-4 | 2A-9026146 |
| 4-Ethoxybenzenesulfonyl chloride | 1132-17-8 | 2A-9026291 |
| 4-Fluorophenyl isocyanate | 1195-45-5 | 2A-9026440 |
| Butanoic acid, 4-[[2-[(1R,2R,3R)-3-hydroxy-2-[(1E,3S)-3-hydroxy-4-[3-(methoxymethyl)phenyl]-1-butenyl]-5-oxocyclopentyl]ethyl]thio]-, methyl ester | 256382-08-8 | 2A-9026624 |
| (S)-(-)-sec-Phenethyl alcohol | 1445-91-6 | 2A-9026812 |
| 2-Chloroquinoxaline | 1448-87-9 | 2A-9026815 |
| Browse all Pharmaceutical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA