
CAS Number1123-85-9
Synonyms2-Phenyl-1-propanol; EINECS 214-379-7; MFCD00004736; β-Methylphenethyl alcohol; Hydratropic Alcohol
Molecular FormulaCH3CH(C6H5)CH2OH
Molecular Weight136.19
Purity98.00%
Density0.975 g/mL at 25 °C(lit.)
Boiling Point110-111 °C10 mm Hg(lit.)
Melting Point-37 °C
AppearanceTransparent colorless transparent liquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1123-85-9 |
| Catalog No. | 2A-9026240 |
| Chinese Name | 2-苯基-1-丙醇 |
| Synonyms | 2-Phenyl-1-propanol; EINECS 214-379-7; MFCD00004736; β-Methylphenethyl alcohol; Hydratropic Alcohol |
| Molecular Formula | CH3CH(C6H5)CH2OH |
| Molecular Weight | 136.19 |
| Purity | 98.00 |
| Density | 0.975 g/mL at 25 °C(lit.) |
| Boiling Point | 110-111 °C10 mm Hg(lit.) |
| Melting Point | -37 °C |
| Appearance | Transparent colorless transparent liquid |
| Water Solubility | insoluble |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 29062900 |
| PubChem ID | 24901296 |
| SMILES | CC(CO)c1ccccc1 |
| InChI | InChI=1S/C9H12O/c1-8(7-10)9-5-3-2-4-6-9/h2-6,8,10H,7H2,1H3 |
| InChI Key | RNDNSYIPLPAXAZ-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified 2-Phenyl-1-propanol Modification number: 5 |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 7-BroMo-3-O-acetyl-pregnenolone | 114417-65-1 | 2A-9026217 |
| 1,4-Dimethyl-2-iodobenzene | 1122-42-5 | 2A-9026219 |
| 4-Methylthiothiophenol | 1122-97-0 | 2A-9026234 |
| 3,5-Dimethyl-2-cyclohexen-1-one | 1123-09-7 | 2A-9026235 |
| 3,3-Dimethylglutarimide | 1123-40-6 | 2A-9026237 |
| 4-Amino-5-(hydroxymethyl)pyrimidin-2-ol | 1123-95-1 | 2A-9026241 |
| 1,4-Dichloro-2,5-dimethylbenzene | 1124-05-6 | 2A-9026243 |
| 4-Bromocyclopropylbenzene | 1124-14-7 | 2A-9026245 |
| Trichlorophenylstannane | 1124-19-2 | 2A-9026246 |
| 1-Pyrrolidino-1-cyclohexene | 1125-99-1 | 2A-9026255 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA