
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1122-42-5 |
| Catalog No. | 2A-9026219 |
| Chinese Name | 1,4-二甲基-2-碘苯 |
| Synonyms | MFCD00013708; EINECS 214-347-2; 2-Iodo-1,4-dimethylbenzene |
| Molecular Formula | C8H9I |
| Molecular Weight | 232.06 |
| Purity | 98.00 |
| Density | 1,617 g/cm3 |
| Boiling Point | 229 °C |
| Appearance | Transparent yellow liquid |
| Storage Condition | Keep container sealed and store in a cool, dry pla |
| HTC | 2903999090 |
| PubChem ID | 70212 |
| SMILES | Cc1ccc(C)c(I)c1 |
| InChI | InChI=1S/C8H9I/c1-6-3-4-7(2)8(9)5-6/h3-5H,1-2H3 |
| InChI Key | WYZVNUSNUCABRF-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Cyclohepten-1-one | 1121-66-0 | 2A-9026209 |
| Glutarimide | 1121-89-7 | 2A-9026214 |
| 2,3-Dibromomaleinimide | 1122-10-7 | 2A-9026215 |
| Dichloromaleic anhydride | 1122-17-4 | 2A-9026216 |
| 7-BroMo-3-O-acetyl-pregnenolone | 114417-65-1 | 2A-9026217 |
| 4-Methylthiothiophenol | 1122-97-0 | 2A-9026234 |
| 3,5-Dimethyl-2-cyclohexen-1-one | 1123-09-7 | 2A-9026235 |
| 3,3-Dimethylglutarimide | 1123-40-6 | 2A-9026237 |
| 2-Phenyl-1-propanol | 1123-85-9 | 2A-9026240 |
| 4-Amino-5-(hydroxymethyl)pyrimidin-2-ol | 1123-95-1 | 2A-9026241 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA