
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 936-02-7 |
| Catalog No. | 2A-9025703 |
| Chinese Name | 水杨酰肼 |
| Synonyms | MFCD00007599; 2-hydroxybenzohydrazide; EINECS 213-311-3 |
| Molecular Formula | C7H8N2O2 |
| Molecular Weight | 152.15100 |
| Purity | 98.00 |
| Density | 1.318g/cm3 |
| Melting Point | 147-150 °C(lit.) |
| Appearance | White to off-white crystalline powder |
| Water Solubility | Soluble in: ethanol, methanol |
| Storage Condition | Keep container sealed and store in a cool, dry pla |
| HTC | 2928000090 |
| SMILES | NNC(=O)c1ccccc1O |
| InChI | InChI=1S/C7H8N2O2/c8-9-7(11)5-3-1-2-4-6(5)10/h1-4,10H,8H2,(H,9,11) |
| InChI Key | XSXYESVZDBAKKT-UHFFFAOYSA-N |
| MSDS | msds/25703_1_936_02_7.pdf |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 4-Acetoxybenzaldehyde | 878-00-2 | 2A-9025533 |
| Methyl 2-(chloromethyl)acrylate | 922-15-6 | 2A-9025591 |
| 2-Ethylacrylaldehyde | 922-63-4 | 2A-9025593 |
| Benzaldoxime | 932-90-1 | 2A-9025682 |
| (2S)-Norbornane-2-carboxylic acid | 934-29-2 | 2A-9025690 |
| 3-(Trifluoromethyl)thiophenol | 937-00-8 | 2A-9025711 |
| Tosyl azide | 941-55-9 | 2A-9025737 |
| trans-4-tert-Butylcyclohexanecarboxylic acid | 943-29-3 | 2A-9025747 |
| 3-(Trifluoromethylthio)benzoic acid | 946-65-6 | 2A-9025756 |
| Methyl 3-(4-bromomethyl)cinnamate | 946-99-6 | 2A-9025757 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA