
CAS Number934-29-2
Synonyms(2S)-Bicyclo[2.2.1]heptane-2-carboxylic acid; (2S)-Norbornane-2-carboxylic acid; 2-Norbornanecarboxylic acid,exo; exo-Norbornane-2-carboxylic acid
Molecular FormulaC8H12O2
Molecular Weight365.42
Purity98.00%
Density1.2±0.1 g/cm3
Boiling Point247.8±8.0 °C at 760 mmHg
Appearancesolid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 934-29-2 |
| Catalog No. | 2A-9025690 |
| Chinese Name | (2S)-降莰烷-2-羧酸 |
| Synonyms | (2S)-Bicyclo[2.2.1]heptane-2-carboxylic acid; (2S)-Norbornane-2-carboxylic acid; 2-Norbornanecarboxylic acid,exo; exo-Norbornane-2-carboxylic acid |
| Molecular Formula | C8H12O2 |
| Molecular Weight | 365.42 |
| Purity | 98.00 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 247.8±8.0 °C at 760 mmHg |
| Appearance | solid |
| HTC | 2916209090 |
| PubChem ID | 329793759 |
| MDL Number | MFCD05663771 |
| SMILES | OC(=O)[C@H]1CCCC[C@@H]1NC(=O)OCC2c3ccccc3-c4ccccc24 |
| InChI | 1S/C22H23NO4/c24-21(25)18-11-5-6-12-20(18)23-22(26)27-13-19-16-9-3-1-7-14(16)15-8-2-4-10-17(15)19/h1-4,7-10,18-20H,5-6,11-13H2,(H,23,26)(H,24,25)/t18-,20-/m0/s1 |
| InChI Key | NZMNDTGOODAUNI-ICSRJNTNSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352106 |
| MSDS | msds/25690_1_934_29_2.pdf |
| Tax Rebate | 9.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Imported food hygiene supervision and inspection S. Export food hygiene supervision and inspection M. Imported commodity inspection N. Exported commodity inspection |
| Transport Info | Product name: Supervision conditions A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 4-(Chloromethyl)benzoyl chloride | 876-08-4 | 2A-9025521 |
| 4-Acetoxybenzaldehyde | 878-00-2 | 2A-9025533 |
| Methyl 2-(chloromethyl)acrylate | 922-15-6 | 2A-9025591 |
| 2-Ethylacrylaldehyde | 922-63-4 | 2A-9025593 |
| Benzaldoxime | 932-90-1 | 2A-9025682 |
| Salicylhydrazide | 936-02-7 | 2A-9025703 |
| 3-(Trifluoromethyl)thiophenol | 937-00-8 | 2A-9025711 |
| Tosyl azide | 941-55-9 | 2A-9025737 |
| trans-4-tert-Butylcyclohexanecarboxylic acid | 943-29-3 | 2A-9025747 |
| 3-(Trifluoromethylthio)benzoic acid | 946-65-6 | 2A-9025756 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA