
CAS Number844-51-9
Synonyms2,5-diphenylcyclohexa-2,5-diene-1,4-dione; MFCD00001600; 2,5-Diphenyl-1,4-benzoquinone; 2,5-Diphenyl-4-benzoquinone; EINECS 212-680-8
Molecular FormulaC18H12O2
Molecular Weight260.29
Purity98.00%
Density1.2±0.1 g/cm3
Boiling Point457.9±45.0 °C at 760 mmHg
Melting Point215-217°C
Appearancebright yellow powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 844-51-9 |
| Catalog No. | 2A-9025414 |
| Chinese Name | 2,5-二苯基-1,4-苯醌 |
| Synonyms | 2,5-diphenylcyclohexa-2,5-diene-1,4-dione; MFCD00001600; 2,5-Diphenyl-1,4-benzoquinone; 2,5-Diphenyl-4-benzoquinone; EINECS 212-680-8 |
| Molecular Formula | C18H12O2 |
| Molecular Weight | 260.29 |
| Purity | 98.00 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 457.9±45.0 °C at 760 mmHg |
| Melting Point | 215-217°C |
| Appearance | bright yellow powder |
| Storage Condition | Keep container sealed and store in a cool, dry pla |
| HTC | 2914399090 |
| MDL Number | MFCD00001600 |
| SMILES | O=C1C=C(c2ccccc2)C(=O)C=C1c1ccccc1 |
| InChI | InChI=1S/C18H12O2/c19-17-12-16(14-9-5-2-6-10-14)18(20)11-15(17)13-7-3-1-4-8-13/h1-12H |
| InChI Key | QYXHDJJYVDLECA-UHFFFAOYSA-N |
| MSDS | msds/25414_1_844_51_9.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 5.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 99.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1,3,5-Tris(2-hydroxyethyl)cyanuric acid | 839-90-7 | 2A-9025407 |
| 2,2-Diphenylpentanoic acid | 841-32-7 | 2A-9025408 |
| Sudan I | 842-07-9 | 2A-9025410 |
| Dipotassium 7-hydroxynaphthalene-1,3-disulphonate | 842-18-2 | 2A-9025411 |
| 4,4'-Cyclohexylidenebisphenol | 843-55-0 | 2A-9025412 |
| Methyl Red sodium salt | 845-10-3 | 2A-9025415 |
| 5a-Androstanedione | 846-46-8 | 2A-9025416 |
| Ethylmetrienone | 848-04-4 | 2A-9025419 |
| Tris(4-methoxyphenyl)phosphine | 855-38-9 | 2A-9025425 |
| Sodium glycocholate | 863-57-0 | 2A-9025430 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA