
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 5682-83-7 |
| Catalog No. | 2A-9002496 |
| Chinese Name | 2-苯亚甲基环己酮 |
| Synonyms | MFCD00070483; EINECS 227-144-9; 2-benzylidenecyclohexanone |
| Molecular Formula | C13H14O |
| Molecular Weight | 186.25000 |
| Purity | 98 |
| Density | 1.09g/cm3 |
| Boiling Point | 180-184°C 14mm |
| Melting Point | 53-55°C |
| Storage Condition | Keep away from light, cool and dry place, sealed a |
| HTC | 2914399090 |
| SMILES | O=C1CCCCC1=Cc1ccccc1 |
| InChI | InChI=1S/C13H14O/c14-13-9-5-4-8-12(13)10-11-6-2-1-3-7-11/h1-3,6-7,10H,4-5,8-9H2/b12-10- |
| InChI Key | VCDPHYIZVFJQCD-BENRWUELSA-N |
| MSDS | msds/2496_1_5682_83_7.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 5.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 95.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Benzoxazolone | 59-49-4 | 2A-9002484 |
| 2-Benzoyl-1,3-indanedione | 1785-95-1 | 2A-9002485 |
| 2-Benzoylvaleronitrile | 1780-48-9 | 2A-9002491 |
| 2-Benzylacrylic acid | 5669-19-2 | 2A-9002493 |
| 2-Benzylcyclohexanone | 946-33-8 | 2A-9002495 |
| 2'-Benzyloxyacetophenone | 31165-67-0 | 2A-9002497 |
| 2-Benzyloxybenzoic acid | 14389-86-7 | 2A-9002499 |
| 2-Benzyloxyphenylacetic acid | 22047-88-7 | 2A-9002500 |
| 2-Benzyloxyphenylacetonitrile | 92552-22-2 | 2A-9002501 |
| 2-Benzylsuccinic acid | 884-33-3 | 2A-9002503 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA