
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 613-42-3 |
| Catalog No. | 2A-9024179 |
| Chinese Name | 4-苄基联苯 |
| Synonyms | EINECS 210-341-9; 1-benzyl-4-phenylbenzene; MFCD00041831 |
| Molecular Formula | C19H16 |
| Molecular Weight | 244.33000 |
| Purity | 98.00 |
| Density | 1.043g/cm3 |
| Boiling Point | 285-286°C 110mm |
| Melting Point | 85-87 °C(lit.) |
| Storage Condition | Storage: Seal the container and store it in a seal |
| HTC | 2902909090 |
| SMILES | c1ccc(Cc2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C19H16/c1-3-7-16(8-4-1)15-17-11-13-19(14-12-17)18-9-5-2-6-10-18/h1-14H,15H2 |
| InChI Key | AGPLQTQFIZBOLI-UHFFFAOYSA-N |
| MSDS | msds/24179_1_613_42_3.pdf |
| Tax Rebate | 9.0% |
| Supervision | None. MFN tariff: 2.0%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Methylanthracene | 613-12-7 | 2A-9024173 |
| 2-Aminoanthracene | 613-13-8 | 2A-9024174 |
| 1,2-Phenylenediacetonitrile | 613-23-0 | 2A-9024175 |
| N,N-Dibutylaniline | 613-29-6 | 2A-9024176 |
| 4-Methoxybiphenyl | 613-37-6 | 2A-9024178 |
| 2-Naphthonitrile | 613-46-7 | 2A-9024181 |
| 2-Bromo-1-(2-naphthyl)-1-ethanone | 613-54-7 | 2A-9024184 |
| 1,2-Bis(cyanomethyl)benzene | 613-73-0 | 2A-9024187 |
| 2-Aminoecetophenone | 613-89-8 | 2A-9024189 |
| N-Methylbenzamide | 613-93-4 | 2A-9024192 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA