
CAS Number602-56-2
SynonymsEINECS 210-020-3; 9-Phenyl-acridin; BIDD:GT0658; MFCD00092562; 9-Phenyl-acridine; Acridine,9-phenyl
Molecular FormulaC19H13N
Molecular Weight255.31300
Purity98.00%
Density1.181 g/cm3
Boiling Point411.1ºC at 760 mmHg
Melting Point184°C
Appearanceyellow powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 602-56-2 |
| Catalog No. | 2A-9023986 |
| Chinese Name | 9-苯基吖啶 |
| Synonyms | EINECS 210-020-3; 9-Phenyl-acridin; BIDD:GT0658; MFCD00092562; 9-Phenyl-acridine; Acridine,9-phenyl |
| Molecular Formula | C19H13N |
| Molecular Weight | 255.31300 |
| Purity | 98.00 |
| Density | 1.181 g/cm3 |
| Boiling Point | 411.1ºC at 760 mmHg |
| Melting Point | 184°C |
| Appearance | yellow powder |
| Storage Condition | Storage: Seal the container and store it in a seal |
| HTC | 2933990090 |
| SMILES | c1ccc(-c2c3ccccc3nc3ccccc23)cc1 |
| InChI | InChI=1S/C19H13N/c1-2-8-14(9-3-1)19-15-10-4-6-12-17(15)20-18-13-7-5-11-16(18)19/h1-13H |
| InChI Key | MTRFEWTWIPAXLG-UHFFFAOYSA-N |
| MSDS | msds/23986_1_602_56_2.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Purity: 0.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-Methyl-2-nitroaniline | 601-87-6 | 2A-9023978 |
| 2,6-Dichloronitrobenzene | 601-88-7 | 2A-9023979 |
| 1,8-Dinitronaphthalene | 602-38-0 | 2A-9023983 |
| Thiocolchicoside | 602-41-5 | 2A-9023984 |
| 9-Phenylanthracene | 602-55-1 | 2A-9023985 |
| 9-Nitroanthracene | 602-60-8 | 2A-9023987 |
| 5-Nitroacenaphthene | 602-87-9 | 2A-9023988 |
| Methyl Violet | 603-47-4 | 2A-9023996 |
| Diethyl nitromalonate | 603-67-8 | 2A-9024000 |
| 2,3-Diaminobenzoic acid | 603-81-6 | 2A-9024005 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA