
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 548-37-8 |
| Catalog No. | 2A-9022813 |
| Chinese Name | 山茱萸苷 |
| Synonyms | Verbenaline; Verbenalinp; CORNIN; VERBENALOSIDE |
| Molecular Formula | C17H24O10 |
| Molecular Weight | 388.37 |
| Purity | 98.00 |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 610.1±55.0 °C at 760 mmHg |
| Melting Point | 180-182ºC |
| Appearance | off-white powder |
| Storage Condition | 2-8C |
| Application | Verbenalin is a verbenaside that has anti-inflammatory, antifungal, and antiviral activities. Verbenalin has a good therapeutic effect on prostatitis. Verbenalin can reduce cerebral ischemia-reperfusi |
| PubChem ID | 329831081 |
| MDL Number | MFCD00017414 |
| SMILES | [H][C@@]12[C@@H](C)CC(=O)[C@]1([H])C(=CO[C@H]2O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)C(=O)OC |
| InChI | 1S/C17H24O10/c1-6-3-8(19)11-7(15(23)24-2)5-25-16(10(6)11)27-17-14(22)13(21)12(20)9(4-18)26-17/h5-6,9-14,16-18,20-22H,3-4H2,1-2H3/t6-,9+,10+,11-,12+,13-,14+,16-,17-/m0/s1 |
| InChI Key | HLXRWTJXGMHOFN-XJSNKYLASA-N |
| Beilstein/REAXYS | 57895 |
| NACRES Code | NA.24 |
| UNSPSC | 41116107 |
| MSDS | msds/22813_1_548_37_8.pdf |
| Transport Info | Product name: Verbenin |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Lithium acetate | 546-89-4 | 2A-9022801 |
| Magnesium carbonate | 546-93-0 | 2A-0201823 |
| D-Turanose | 547-25-1 | 2A-9022804 |
| Methyl Orange | 547-58-0 | 2A-9022806 |
| Methyl isobutyrate | 547-63-7 | 2A-9022807 |
| Tris(4-aminophenyl)methane | 548-61-8 | 2A-9022814 |
| Basic Violet 3 | 548-62-9 | 2A-9022815 |
| Droperidol | 548-73-2 | 2A-9022816 |
| Tectorigenin | 548-77-6 | 2A-9022817 |
| N-Methylphthalimide | 550-44-7 | 2A-9022820 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA