
CAS Number539-44-6
SynonymsP-TOLYLHYDRAZINE; P-METHYLPHENYLHYDRAZINE; p-toluenesulfonyl hydrazide; Hydrazine,p-tolyl; para-Tolylhydrazine; MFCD00060553; 4-Methyl-1-hydrazinobenzene; Einecs 208-717-2
Molecular FormulaC7H10N2
Molecular Weight122.17
Purity98.00%
Density1.087 g/cm3
Boiling Point242.8ºC at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 539-44-6 |
| Catalog No. | 2A-9022715 |
| Chinese Name | 对甲基苯肼 |
| Synonyms | P-TOLYLHYDRAZINE; P-METHYLPHENYLHYDRAZINE; p-toluenesulfonyl hydrazide; Hydrazine,p-tolyl; para-Tolylhydrazine; MFCD00060553; 4-Methyl-1-hydrazinobenzene; Einecs 208-717-2 |
| Molecular Formula | C7H10N2 |
| Molecular Weight | 122.17 |
| Purity | 98.00 |
| Density | 1.087 g/cm3 |
| Boiling Point | 242.8ºC at 760 mmHg |
| Storage Condition | 2-8°C |
| HTC | 2928000090 |
| MDL Number | MFCD00060553 |
| SMILES | Cc1ccc(NN)cc1 |
| InChI | InChI=1S/C7H10N2.ClH/c1-6-2-4-7(9-8)5-3-6;/h2-5,9H,8H2,1H3;1H |
| InChI Key | XAMBIJWZVIZZOG-UHFFFAOYSA-N |
| MSDS | msds/22715_1_539_44_6.pdf |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Summary 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1,5-Diphenylpenta-1,4-dien-3-one | 538-58-9 | 2A-9022704 |
| Dibenzyl sulphide | 538-74-9 | 2A-9022707 |
| Benzyl methyl ether | 538-86-3 | 2A-9022709 |
| Isobutylbenzene | 538-93-2 | 2A-9022710 |
| Ambazone | 539-21-9 | 2A-9022713 |
| 1,4-Bis(aminomethyl)benzene | 539-48-0 | 2A-9022717 |
| Ethyl 3-bromopropionate | 539-74-2 | 2A-9022718 |
| Ethyl valerate | 539-82-2 | 2A-9022719 |
| Methylsulfinylmethane | 8070-53-9 | 2A-9022720 |
| Isobutyl butyrate | 539-90-2 | 2A-9022722 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA