
CAS Number30273-41-7
Synonyms3.5-Dibrom-2-amino-toluol; MFCD00735681; 2,4-Dibromo-6-methylaniline; 4,6-Dibromo-o-toluidine; 2,3-O-ISOPROPYLIDENE-D-ALLONIC ACID; 4.6-Dibrom-o-toluidin; 2,4-dibromo-6-methyl-aniline
Molecular FormulaC7H7N1Br2
Molecular Weight264.95
Purity98%
Density1.9±0.1 g/cm3
Boiling Point281.2±35.0 °C at 760 mmHg
Melting Point44-49ºC
AppearanceOff-white to gray or light brown crystalline powder
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 30273-41-7 |
| Catalog No. | 2A-9002241 |
| Chinese Name | 2,4-二溴-6-甲基苯胺 |
| Synonyms | 3.5-Dibrom-2-amino-toluol; MFCD00735681; 2,4-Dibromo-6-methylaniline; 4,6-Dibromo-o-toluidine; 2,3-O-ISOPROPYLIDENE-D-ALLONIC ACID; 4.6-Dibrom-o-toluidin; 2,4-dibromo-6-methyl-aniline |
| Molecular Formula | C7H7N1Br2 |
| Molecular Weight | 264.95 |
| Purity | 98 |
| Density | 1.9±0.1 g/cm3 |
| Boiling Point | 281.2±35.0 °C at 760 mmHg |
| Melting Point | 44-49ºC |
| Appearance | Off-white to gray or light brown crystalline powder |
| Storage Condition | Sealed in a cool, dry environment |
| HTC | 2921430090 |
| MDL Number | MFCD00735681 |
| SMILES | Cc1cc(Br)cc(Br)c1N |
| InChI | InChI=1S/C7H7Br2N/c1-4-2-5(8)3-6(9)7(4)10/h2-3H,10H2,1H3 |
| InChI Key | LOOOTYOQFFOBCI-UHFFFAOYSA-N |
| Hazard Symbols | Xn |
| Risk Codes | R20/21/22;R36/37/38 |
| Safety Description | S26;S36/37/39 |
| MSDS | msds/2241_1_30273_41_7.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS:2921430090 toluidines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Industrial Applications | ||
|---|---|---|
| 2,6-Dimethoxytoluene | 5673-07-4 | 2A-9002140 |
| 2-[2'-(Methylamino)ethyl]benzenemethanol | 2A-102179 | 2A-9002179 |
| 2-[3-(4-Nitrophenyl)propylamino]ethanol | 130634-09-2 | 2A-9002183 |
| 2-Acetyltoluene | 577-16-2 | 2A-9002221 |
| 2-Amino-1-(2,3-dihydrobenzo[1,4]dioxin-6-yl)ethanol | 4384-99-0 | 2A-9002223 |
| 2-Amino-4-hydroxytoluene(3-Amino-4-methylphenol) | 2836-00-2 | 2A-9002331 |
| 2-Benzoxazol-2-yl-1-(4-tert-butylphenyl)ethanol | 2A-102482 | 2A-9002482 |
| 2-Benzoylhexanenitrile | 561305-79-1 | 2A-9002488 |
| 2-Bromo-4-chlorotoluene | 27139-97-5 | 2A-9002621 |
| 2-Bromo-4-fluorotoluene | 1422-53-3 | 2A-9002643 |
| Browse all Industrial Applications products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA