![2-[3-(4-Nitrophenyl)propylamino]ethanol structure, CAS 130634-09-2](/structures/20000/2183_1_130634_09_2.png)
CAS Number130634-09-2
Synonyms2-{[3-(4-Nitrophenyl)propyl]amino}ethanol; 2-((3-(4-Nitrophenyl)propyl)amino)ethanol; N-(2-hydroxyethyl)-N-[3-(4-nitrophenyl)propyl]amine; MFCD00012482; Ethanol,2-[[3-(4-nitrophenyl)propyl]amino]; N-(2-Hydroxyethyl)-3-(4-nitrophenyl) propylamine; AC-4713
Molecular FormulaC25H25F2N3O5
Molecular Weight485.492
Purity98%
Density1.2±0.1 g/cm3
Boiling Point397.9±27.0 °C at 760 mmHg
Appearancepowder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 130634-09-2 |
| Catalog No. | 2A-9002183 |
| Chinese Name | N-(2-羟乙基)-3-(4-硝基苯基)丙胺 |
| Synonyms | 2-{[3-(4-Nitrophenyl)propyl]amino}ethanol; 2-((3-(4-Nitrophenyl)propyl)amino)ethanol; N-(2-hydroxyethyl)-N-[3-(4-nitrophenyl)propyl]amine; MFCD00012482; Ethanol,2-[[3-(4-nitrophenyl)propyl]amino]; N-(2-Hydroxyethyl)-3-(4-nitrophenyl) propylamine; AC-4713 |
| Molecular Formula | C25H25F2N3O5 |
| Molecular Weight | 485.492 |
| Purity | 98 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 397.9±27.0 °C at 760 mmHg |
| Appearance | powder |
| Storage Condition | 2-8℃, dry, sealed |
| HTC | 2922199090 |
| MDL Number | MFCD05151075 |
| SMILES | O=[N+]([O-])c1ccc(CCCNCCO)cc1 |
| InChI Key | RGJQCMUPYAXGNG-UHFFFAOYSA-N |
| MSDS | msds/2183_1_130634_09_2.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Industrial Applications | ||
|---|---|---|
| 2,6-Diaminotoluene-4-sulfonic acid | 98-25-9 | 2A-9002044 |
| 2,6-Difluorotoluene | 443-84-5 | 2A-9002126 |
| 2,6-Dihydroxytoluene | 608-25-3 | 2A-9002132 |
| 2,6-Dimethoxytoluene | 5673-07-4 | 2A-9002140 |
| 2-[2'-(Methylamino)ethyl]benzenemethanol | 2A-102179 | 2A-9002179 |
| 2-Acetyltoluene | 577-16-2 | 2A-9002221 |
| 2-Amino-1-(2,3-dihydrobenzo[1,4]dioxin-6-yl)ethanol | 4384-99-0 | 2A-9002223 |
| 2-Amino-3, 5-dibromotoluene | 30273-41-7 | 2A-9002241 |
| 2-Amino-4-hydroxytoluene(3-Amino-4-methylphenol) | 2836-00-2 | 2A-9002331 |
| 2-Benzoxazol-2-yl-1-(4-tert-butylphenyl)ethanol | 2A-102482 | 2A-9002482 |
| Browse all Industrial Applications products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA