
CAS Number488-23-3
Synonyms1,2,3,4-Tetramethylbenzene; MFCD00008528; Prehnitene; EINECS 202-465-7; tetramethylbenzene
Molecular FormulaC10H14
Molecular Weight134.218
Purity98.00%
Density0.9±0.1 g/cm3
Boiling Point204.0±35.0 °C at 760 mmHg
Melting Point76-80 °C(lit.)
Appearancecolorless liquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 488-23-3 |
| Catalog No. | 2A-9022210 |
| Chinese Name | 1,2,3,4-四甲基苯 |
| Synonyms | 1,2,3,4-Tetramethylbenzene; MFCD00008528; Prehnitene; EINECS 202-465-7; tetramethylbenzene |
| Molecular Formula | C10H14 |
| Molecular Weight | 134.218 |
| Purity | 98.00 |
| Density | 0.9±0.1 g/cm3 |
| Boiling Point | 204.0±35.0 °C at 760 mmHg |
| Melting Point | 76-80 °C(lit.) |
| Appearance | colorless liquid |
| Storage Condition | Store sealed and placed in a ventilated, dry envir |
| Application | 1,2,3,4-Tetramethylbenzene, whose structure consists of a benzene ring with four methyl groups (-CH3) as substituents, is used in biochemical research. |
| SMILES | Cc1ccc(C)c(C)c1C |
| InChI | InChI=1S/C10H14/c1-7-5-6-8(2)10(4)9(7)3/h5-6H,1-4H3 |
| InChI Key | InChIKey=UOHMMEJUHBCKEE-UHFFFAOYSA-N |
| MSDS | msds/22210_1_488_23_3.pdf |
| Transport Info | Product Name: 1,2,3,4-Tetramethylbenzene |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Caulophylline | 486-86-2 | 2A-9022197 |
| Elemicin | 487-11-6 | 2A-9022199 |
| Lumazine | 487-21-8 | 2A-9022200 |
| Mucobromic acid | 488-11-9 | 2A-9022208 |
| 3-Methylcatechol | 488-17-5 | 2A-9022209 |
| D-(+)-Arabitol | 488-81-3 | 2A-0202346 |
| Croconic acid | 488-86-8 | 2A-9022213 |
| Guaiazulene | 489-84-9 | 2A-9022216 |
| 5,7-Dihydrox -4'-methoxyisoflavone | 491-80-5 | 2A-9022231 |
| Thioxanthen-9-one | 492-22-8 | 2A-9022232 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA