
CAS Number479-66-3
Synonymsfulvic acid; Nordic Aquatic Fulvic Acid; Elliott Soil Fulvic Acid; EINECS 215-809-6; Florida Peat Fulvic Acid; Suwannee River Fulvic Acid
Molecular FormulaC14H12O8
Molecular Weight308.24
Purity95.00%
Density1.79 g/cm3
Boiling Point661ºC at 760 mmHg
Melting Point247ºC
AppearanceYellow crystalline solid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 479-66-3 |
| Catalog No. | 2A-9022130 |
| Chinese Name | 黄腐酸 |
| Synonyms | fulvic acid; Nordic Aquatic Fulvic Acid; Elliott Soil Fulvic Acid; EINECS 215-809-6; Florida Peat Fulvic Acid; Suwannee River Fulvic Acid |
| Molecular Formula | C14H12O8 |
| Molecular Weight | 308.24 |
| Purity | 95.00 |
| Density | 1.79 g/cm3 |
| Boiling Point | 661ºC at 760 mmHg |
| Melting Point | 247ºC |
| Appearance | Yellow crystalline solid |
| Storage Condition | Room temperature, dry, sealed |
| Application | Fulvic acid is a natural health product derived from humic substances produced by microorganisms in the soil. Fulvic acid can regulate the immune system, affect the oxidative state of cells, and impro |
| MDL Number | MFCD09838488 |
| SMILES | CC1(O)Cc2oc3cc(O)c(O)c(C(=O)O)c3c(=O)c2CO1 |
| InChI | InChI=1S/C14H12O8/c1-14(20)3-8-5(4-21-14)11(16)9-7(22-8)2-6(15)12(17)10(9)13(18)19/h2,15,17,20H,3-4H2,1H3,(H,18,19) |
| InChI Key | FCYKAQOGGFGCMD-UHFFFAOYSA-N |
| MSDS | msds/22130_1_479_66_3.pdf |
| Transport Info | Product name: Fulvic acid |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Tetraphenylcyclopentadienone | 479-33-4 | 2A-9022125 |
| Indirubin | 479-41-4 | 2A-9022126 |
| Lucanthone | 479-50-5 | 2A-9022127 |
| Julolidine | 479-59-4 | 2A-9022128 |
| Chlorophyll a | 479-61-8 | 2A-9022129 |
| Propyphenazone | 479-92-5 | 2A-9022132 |
| Morin | 480-16-0 | 2A-9022135 |
| Tributyl(1-ethoxyvinyl)tin | 97674-02-7 | 2A-9022143 |
| 2,6-Dihydroxy-4-methylbenzoic acid | 480-67-1 | 2A-9022146 |
| 5-Nitrobarbituric acid | 480-68-2 | 2A-9022147 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA