CAS Number475-20-7
SynonymsJunipen; (+)-longifollene; Kuromatsuene; (1S,3aR,4S,8aS)-decahydro-4,8,8-trimethyl-9-methylene-1,4-methanoazulene; (+)-Longofolene; (+)-Longifolen; (+)-LONGIFOLENE; EINECS 207-491-2; Longifolene; UNII:3YXH7YY8WM; Junipene; d-longifolene; Kuromatsuen; 8abeta)]-4alpha; (1R,2S,7S,9S)-3,3,7-Trimethyl-8-methylenetricyclo[5.4.0.0]undecane; MFCD00082306
Molecular FormulaC15H24
Molecular Weight204.35
Purity≥75.0 (GC)%
Density0.9±0.1 g/cm3
Boiling Point254 °C/706 mmHg (lit.)
AppearanceLight yellow oily liquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 475-20-7 |
| Catalog No. | 2A-9022104 |
| Chinese Name | 长叶烯 |
| Synonyms | Junipen; (+)-longifollene; Kuromatsuene; (1S,3aR,4S,8aS)-decahydro-4,8,8-trimethyl-9-methylene-1,4-methanoazulene; (+)-Longofolene; (+)-Longifolen; (+)-LONGIFOLENE; EINECS 207-491-2; Longifolene; UNII:3YXH7YY8WM; Junipene; d-longifolene; Kuromatsuen; 8abeta)]-4alpha; (1R,2S,7S,9S)-3,3,7-Trimethyl-8-methylenetricyclo[5.4.0.0]undecane; MFCD00082306 |
| Molecular Formula | C15H24 |
| Molecular Weight | 204.35 |
| Purity | ≥75.0 (GC) |
| Density | 0.9±0.1 g/cm3 |
| Boiling Point | 254 °C/706 mmHg (lit.) |
| Appearance | Light yellow oily liquid |
| Storage Condition | This product should be sealed with argon gas and s |
| Application | (+)-Longifolin is a sesquiterpenoid compound and a metabolite found in rabbits. (+)-Longifolin is converted into primary, secondary or tertiary alcohols in rabbits, with primary alcohols being the pre |
| MDL Number | MFCD00082306 |
| SMILES | CC1(C)CCC[C@]2(C)C3CCC(C13)C2=C |
| InChI | 1S/C15H24/c1-10-11-6-7-12-13(11)14(2,3)8-5-9-15(10,12)4/h11-13H,1,5-9H2,2-4H3/t11?,12?,13?,15-/m0/s1 |
| InChI Key | PDSNLYSELAIEBU-WOFVOEOOSA-N |
| Beilstein/REAXYS | 2044263 |
| NACRES Code | NA.24 |
| UNSPSC | 41116107 |
| MSDS | msds/22104_1_475_20_7.pdf |
| Transport Info | Product Name: (+)-Longifolene |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Stevioside | 471-80-7 | 2A-9022093 |
| N,N-Dimethyl-L-proline | 471-87-4 | 2A-9022094 |
| alpha-Cyperone | 473-08-5 | 2A-9022098 |
| beta-Eudesmol | 473-15-4 | 2A-9022099 |
| 2-Methyl-3-hydroxybutyric acid | 473-86-9 | 2A-9022100 |
| Glycocholic acid | 475-31-0 | 2A-9022105 |
| 5,8-Dihydroxy-1,4-naphthoquinone | 475-38-7 | 2A-9022106 |
| Vat Yellow 1 | 475-71-8 | 2A-9022108 |
| 1,2,3-Trithiane-4-pentanoic Acid | 1204245-29-3 | 2A-9022109 |
| Anthracene-1,4,9,10-tetraol | 476-60-8 | 2A-9022111 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS