
CAS Number329-01-1
Synonymsα,α,α-Trifluoro-m-tolyl Isocyanate; 3-Isocyanatobenzotrifluoride; 3-trifluoromethylisocyanate; a,a,a-Trifluoro-m-tolyl isocyanate; 3-CF3phenylisocyanate; 3-(Trifluoromethyl)phenyl Isocyanate; Isocyanobenzotrifluoride; m-trifluoromethylphenyl isocyanate; MFCD00002020; alpha,alpha,alpha-Trifluoro-m-tolyl isocyanate; 1-Isocyanato-3-(trifluoromethyl)benzene; Isocyanic Acid 3-(Trifluoromethyl)phenyl Ester; EINECS 206-341-3
Molecular FormulaClC6H3(CF3)NCO
Molecular Weight221.56
Purity98%
Density1.336
Boiling Point86-90 °C/14 mmHg (lit.)
Melting Point40-42 °C (lit.)
AppearanceColorless to light yellow liquid
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 329-01-1 |
| Catalog No. | 2A-9021316 |
| Chinese Name | 3-(三氟甲基)异氰酸苯酯 |
| Synonyms | α,α,α-Trifluoro-m-tolyl Isocyanate; 3-Isocyanatobenzotrifluoride; 3-trifluoromethylisocyanate; a,a,a-Trifluoro-m-tolyl isocyanate; 3-CF3phenylisocyanate; 3-(Trifluoromethyl)phenyl Isocyanate; Isocyanobenzotrifluoride; m-trifluoromethylphenyl isocyanate; MFCD00002020; alpha,alpha,alpha-Trifluoro-m-tolyl isocyanate; 1-Isocyanato-3-(trifluoromethyl)benzene; Isocyanic Acid 3-(Trifluoromethyl)phenyl Ester; EINECS 206-341-3 |
| Molecular Formula | ClC6H3(CF3)NCO |
| Molecular Weight | 221.56 |
| Purity | 98 |
| Density | 1.336 |
| Boiling Point | 86-90 °C/14 mmHg (lit.) |
| Melting Point | 40-42 °C (lit.) |
| Appearance | Colorless to light yellow liquid |
| Water Solubility | Soluble in: Toluene |
| Storage Condition | The warehouse is ventilated and dried at low tempe |
| Packaging | II |
| HTC | 2929109000 |
| PubChem ID | 24863347 |
| MDL Number | MFCD00013874 |
| SMILES | FC(F)(F)c1cc(ccc1Cl)N=C=O |
| InChI | 1S/C8H3ClF3NO/c9-7-2-1-5(13-4-14)3-6(7)8(10,11)12/h1-3H |
| InChI Key | NBJZEUQTGLSUOB-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| Hazard Symbols | 6.1 |
| MSDS | msds/21316_1_329_01_1.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2929109000. other isocyanates. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Pharmaceutical Intermediates | ||
|---|---|---|
| Imidazo[1,2-a]pyrimidine | 274-95-3 | 2A-9021102 |
| 2-Azabicyclo[2.2.1]heptane | 279-24-3 | 2A-9021103 |
| (R)-(-)-GLYCIDYL PHTHALIMIDE | 181140-34-1 | 2A-9021114 |
| Perfluoro-1-octanesulfonyl fluoride | 307-35-7 | 2A-9021205 |
| 4-Chloro-3-(trifluoromethyl)phenyl isocyanate | 327-78-6 | 2A-9021294 |
| Phenylmethylsulfonyl fluoride | 329-98-6 | 2A-9021324 |
| 5-Fluoro-2-methylbenzenesulfonyl chloride | 445-05-6 | 2A-9021882 |
| 3-(Methylthio)propyl isothiocyanate | 505-79-3 | 2A-9022364 |
| (S)-(+)-2-Aminobutane | 513-49-5 | 2A-9022411 |
| (1R,2R)-2-(3,4-difluorophenyl)cyclopropanamine(S)-(carboxylato(phenyl)methyl)holmium | 376608-71-8 | 2A-9022586 |
| Browse all Pharmaceutical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA