
CAS Number328-79-0
Synonyms3-methoxy-3-nitro-5-(trifluoromethyl)benzene; 1-methoxy-3-nitro-5-trifluoromethyl-benzene; 1-Methoxy-3-nitro-5-(trifluoromethyl)benzene; 3-Methoxy-5-nitrobenzotrifluoride; 3-nitro-5-trifluoromethyl-anisole; MFCD00010446; Methyl 3-nitro-5-(trifluoromethyl)phenyl ether; 5-methoxy-1-nitro-3-(trifluoromethyl)benzene; 3-Nitro-5-trifluormethyl-anisol; 5-methoxy-3-nitrobenzotrifluoride
Molecular FormulaC8H6F3NO3
Molecular Weight205.21
Purity98%
Density1.4±0.1 g/cm3
Boiling Point246.9±40.0 °C at 760 mmHg
Melting Point145-148 °C (dec.) (lit.)
Appearancecolorless liquid
EINECS222-438-3
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 328-79-0 |
| Catalog No. | 2A-9021309 |
| Chinese Name | 3-甲氧基-5-硝基三氟甲苯 |
| Synonyms | 3-methoxy-3-nitro-5-(trifluoromethyl)benzene; 1-methoxy-3-nitro-5-trifluoromethyl-benzene; 1-Methoxy-3-nitro-5-(trifluoromethyl)benzene; 3-Methoxy-5-nitrobenzotrifluoride; 3-nitro-5-trifluoromethyl-anisole; MFCD00010446; Methyl 3-nitro-5-(trifluoromethyl)phenyl ether; 5-methoxy-1-nitro-3-(trifluoromethyl)benzene; 3-Nitro-5-trifluormethyl-anisol; 5-methoxy-3-nitrobenzotrifluoride |
| Molecular Formula | C8H6F3NO3 |
| Molecular Weight | 205.21 |
| Purity | 98 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 246.9±40.0 °C at 760 mmHg |
| Melting Point | 145-148 °C (dec.) (lit.) |
| Appearance | colorless liquid |
| Storage Condition | Keep the receptacle sealed, stored in a cool, dry |
| Packaging | III |
| EINECS | 222-438-3 |
| HTC | 2909309090 |
| PubChem ID | 24896651 |
| MDL Number | MFCD00005638 |
| SMILES | COc1ccc2[nH]cc(CC(O)=O)c2c1 |
| InChI | 1S/C11H11NO3/c1-15-8-2-3-10-9(5-8)7(6-12-10)4-11(13)14/h2-3,5-6,12H,4H2,1H3,(H,13,14) |
| InChI Key | COCNDHOPIHDTHK-UHFFFAOYSA-N |
| Beilstein/REAXYS | 187161 |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| Hazard Symbols | 8 |
| MSDS | msds/21309_1_328_79_0.pdf |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Summary 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Piperonyl acetate | 326-61-4 | 2A-9021282 |
| D-Norleucine | 327-56-0 | 2A-9021290 |
| L-Norleucine | 327-57-1 | 2A-9021291 |
| Oxalacetic acid | 328-42-7 | 2A-9021300 |
| 2-Ketoglutaric acid | 328-50-7 | 2A-9021301 |
| 3,4-Dichlorobenzotrifluoride | 328-84-7 | 2A-9021311 |
| Methyl 4-fluoro-3-nitrobenzoate | 329-59-9 | 2A-9021319 |
| DL-Adrenalin | 329-65-7 | 2A-9021320 |
| 1-(4-Chlorophenyl)-2-fluoroethanone | 329-78-2 | 2A-9021321 |
| Benzyltrimethylammonium fluoride | 329-97-5 | 2A-9021323 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA