CAS Number140-93-2
SynonymsSodium Isoproylxanthate; proxan; Proxan sodium; aeroxanthate343; sodium O-isopropyl xanthate; isopropylxanthogenansodny; MFCD00067275; sodium O-(1-methylethyl) carbonodithioate; sodium salt of isopropyl xantate; EINECS 205-443-5; sodium O-isopropyl dithiocarbonate; O-isopropylxanthic acid sodium salt; SODIUM ISOPROPYLXANTHATE; sodium O-propan-2-yl carbonodithioate; good-ritenix; sodium isopropyl xanthogenate; isopropyl xanthate sodium salt; z11
Molecular FormulaC4H7NaOS2
Molecular Weight304.27
Purity≥98 (HPLC)%
Density1.225
Boiling Point166℃
Melting Point216-218 °C(lit.)
Appearancepowder
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 140-93-2 |
| Catalog No. | 2A-9020862 |
| Chinese Name | 异丙黄药 |
| Synonyms | Sodium Isoproylxanthate; proxan; Proxan sodium; aeroxanthate343; sodium O-isopropyl xanthate; isopropylxanthogenansodny; MFCD00067275; sodium O-(1-methylethyl) carbonodithioate; sodium salt of isopropyl xantate; EINECS 205-443-5; sodium O-isopropyl dithiocarbonate; O-isopropylxanthic acid sodium salt; SODIUM ISOPROPYLXANTHATE; sodium O-propan-2-yl carbonodithioate; good-ritenix; sodium isopropyl xanthogenate; isopropyl xanthate sodium salt; z11 |
| Molecular Formula | C4H7NaOS2 |
| Molecular Weight | 304.27 |
| Purity | ≥98 (HPLC) |
| Density | 1.225 |
| Boiling Point | 166℃ |
| Melting Point | 216-218 °C(lit.) |
| Appearance | powder |
| Storage Condition | The warehouse is ventilated and dried at low tempe |
| Packaging | II |
| HTC | 2930902000 |
| SMILES | CC(C)OC(=S)[S-].[Na+] |
| InChI | InChI=1S/C4H8OS2.Na/c1-3(2)5-4(6)7;/h3H,1-2H3,(H,6,7);/q;+1/p-1 |
| InChI Key | IRZFQKXEKAODTJ-UHFFFAOYSA-M |
| Hazard Symbols | 4.2 |
| MSDS | msds/20862_1_140_93_2.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2930902000. other dithiocarbonates (xanthates). VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-Allylanisole | 140-67-0 | 2A-9020849 |
| 1-Hexadecylpyridinium bromide | 140-72-7 | 2A-9020850 |
| 3-Cyclopentylpropionic acid | 140-77-2 | 2A-9020854 |
| 6-Ethyl-3-oxa-6-azaoctanol | 140-82-9 | 2A-9020856 |
| Potassium ethylxanthate | 140-89-6 | 2A-9020859 |
| Dimethylolurea | 140-95-4 | 2A-9020863 |
| Diisobutyl adipate | 141-04-8 | 2A-9020866 |
| Trichloropropylsilane | 141-57-1 | 2A-9020877 |
| Decamethyltetrasiloxane | 141-62-8 | 2A-9020878 |
| Carbamoylguanidine | 141-83-3 | 2A-9020883 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS