
CAS Number133-47-1
SynonymsFumaric acid,dihydroxy-,dimethyl ester; dihydroxyfumaric acid dimethyl ester; Dihydroxy-fumarsaeure-dimethylester; Dimethyl dihydroxyfumarate; Dihydroxy-fumarsaure-dimethylester; Methyl 3,4-dihydroxy-4-methoxy-2-oxobut-3-enoate
Molecular FormulaC6H8O6
Molecular Weight176.12400
Purity98.00%
Density1.434
Boiling Point272.1ºC at 760mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 133-47-1 |
| Catalog No. | 2A-9020708 |
| Chinese Name | 二羟基富马酸二甲酯 |
| Synonyms | Fumaric acid,dihydroxy-,dimethyl ester; dihydroxyfumaric acid dimethyl ester; Dihydroxy-fumarsaeure-dimethylester; Dimethyl dihydroxyfumarate; Dihydroxy-fumarsaure-dimethylester; Methyl 3,4-dihydroxy-4-methoxy-2-oxobut-3-enoate |
| Molecular Formula | C6H8O6 |
| Molecular Weight | 176.12400 |
| Purity | 98.00 |
| Density | 1.434 |
| Boiling Point | 272.1ºC at 760mmHg |
| HTC | 2918199090 |
| SMILES | COC(=O)C(O)=C(O)C(=O)OC |
| InChI | InChI=1S/C6H8O6/c1-11-5(9)3(7)4(8)6(10)12-2/h7,9H,1-2H3/b5-3- |
| InChI Key | HMPNVUONVWQKFY-ONEGZZNKSA-N |
| Tax Rebate | 9.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1-Naphthyl acetonitrile | 132-75-2 | 2A-9020694 |
| 1,3-Dihydroxynaphthalene | 132-86-5 | 2A-9020695 |
| (-)-Asarinin | 133-04-0 | 2A-9020697 |
| Phenyl-4-aminosalicylate | 133-11-9 | 2A-9020702 |
| Calcium 4-aminosalicylate | 133-15-3 | 2A-9020705 |
| Pentachlorothiophenol | 133-49-3 | 2A-9020709 |
| 5-Chloroorthanilic acid | 133-74-4 | 2A-9020714 |
| 3,5-Diiodosalicylic acid | 133-91-5 | 2A-9020716 |
| D-(+)-Cellobiose | 133-99-3 | 2A-9020717 |
| Sodium ascorbate | 134-03-2 | 2A-9020718 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA