
CAS Number131-52-2
Synonymspentachlorophenol sodium salt; natriumpentachlorphenolat; pkhfn; napclor-g; gr48-32s; 2,3,4,5,6-pentachlorophenol sodium salt; Sodium pentachlorophenolate; dowicideg; sapco25; potassium pentachlorophenoxide; pentachlorophenate de sodium; pentachlorophenate sodium salt; mystoxd; sodiumpcp; MFCD00149086; SODIUM PENTACHLOROPHENOXIDE; sodium pentachlorophenate; sodium pentachlorophenol*xH2O; sodium pentachloropthenol; sodium salt of pentachlorophenol; gr48-11ps; EINECS 205-025-2; Phenol, 2,3,4,5,6-pentachloro-, sodium salt (1:1); pentachlorophenol sodium alt; PCP-Na
Molecular FormulaC6Cl5NaO
Molecular Weight288.318
Purity98.00%
Density1.804g/cm3
Boiling Point309.5ºC at 760mmHg
Melting Point>300°C
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 131-52-2 |
| Catalog No. | 2A-9020670 |
| Chinese Name | 五氯酚钠 |
| Synonyms | pentachlorophenol sodium salt; natriumpentachlorphenolat; pkhfn; napclor-g; gr48-32s; 2,3,4,5,6-pentachlorophenol sodium salt; Sodium pentachlorophenolate; dowicideg; sapco25; potassium pentachlorophenoxide; pentachlorophenate de sodium; pentachlorophenate sodium salt; mystoxd; sodiumpcp; MFCD00149086; SODIUM PENTACHLOROPHENOXIDE; sodium pentachlorophenate; sodium pentachlorophenol*xH2O; sodium pentachloropthenol; sodium salt of pentachlorophenol; gr48-11ps; EINECS 205-025-2; Phenol, 2,3,4,5,6-pentachloro-, sodium salt (1:1); pentachlorophenol sodium alt; PCP-Na |
| Molecular Formula | C6Cl5NaO |
| Molecular Weight | 288.318 |
| Purity | 98.00 |
| Density | 1.804g/cm3 |
| Boiling Point | 309.5ºC at 760mmHg |
| Melting Point | >300°C |
| Storage Condition | Store in a ventilated, low-temperature, dry wareho |
| Packaging | II |
| HTC | 2908199023 |
| SMILES | [Na+].[O-]c1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C6HCl5O.Na/c7-1-2(8)4(10)6(12)5(11)3(1)9;/h12H;/q;+1/p-1 |
| InChI Key | HCJLVWUMMKIQIM-UHFFFAOYSA-M |
| Hazard Symbols | 6.1(a) |
| MSDS | msds/20670_2_131_52_2.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2908199090. Derivatives of polyphenols or phenol-alcohols containing only halogen substituents and their salts. VAT:17.0%. tax rebate rate:9.0%. supervision conditions:None. MFN tariff:5.5%. general tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Pamoic acid | 130-85-8 | 2A-0202222 |
| (-)-Berbine | 131-10-2 | 2A-9020663 |
| Dimethyl phthalate | 131-11-3 | 2A-9020664 |
| Pimpinellin | 131-12-4 | 2A-9020665 |
| 2-Amino-4,8-naphthalenedisulfonic acid | 131-27-1 | 2A-9020668 |
| 2,2'-Dihydroxy-4-methoxybenzophenone | 131-53-3 | 2A-9020671 |
| 2,2'-Dihydroxy-4,4'-dimethoxybenzophenone | 131-54-4 | 2A-9020672 |
| Vat Brown 3 | 131-92-0 | 2A-9020678 |
| Iron phthalocyanine | 132-16-1 | 2A-9020679 |
| Benztropine mesylate | 132-17-2 | 2A-9020680 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA