
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 35877-04-4 |
| Catalog No. | 2A-9002035 |
| Chinese Name | 2,6-双(三氟甲基)-4-羟基喹啉 |
| Synonyms | 2,6-Bis(trifluoromethyl)quinolin-4-ol; MFCD00276581 |
| Molecular Formula | C11H5O1N1F6 |
| Molecular Weight | 281.16 |
| Purity | 97 |
| Density | 1.469g/cm3 |
| Boiling Point | 220.2ºC at 760 mmHg |
| Melting Point | 280-290°C |
| Appearance | solid |
| Storage Condition | Sealed, cool, dry and ventilated storage |
| HTC | 2933499090 |
| MDL Number | MFCD25542084 |
| SMILES | O=c1cc(C(F)(F)F)[nH]c2ccc(C(F)(F)F)cc12 |
| InChI Key | AOGNHURBEDTPIZ-UHFFFAOYSA-N |
| MSDS | msds/2035_1_35877_04_4.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 2,5-Dimethyl-1-[4-(trifluoromethyl)phenyl]pyrrole | 570-05-8 | 2A-9002024 |
| 2,5-Dimethyl-4-(2-thienylaminosulphonyl)furan-3-carboxylic acid | 306936-40-3 | 2A-9002025 |
| 2,5-Dimethylbenzoxazole | 5676-58-4 | 2A-9002027 |
| 2,5-Dimethylthiazole | 4175-66-0 | 2A-9002029 |
| 2,5-Dimethylthiophene | 638-02-8 | 2A-9002030 |
| 2,6-Bis(trifluoromethyl)pyridine | 455-00-5 | 2A-9002037 |
| 2,6-Di(oxiran-2-ylmethyl)-1,2,3,5,6,7-hexahydropyrrolo[3,4-f]isoindole-1,3,5,7-tetraone | 23328-66-7 | 2A-9002038 |
| 2,6-Diacetylpyridine | 1129-30-2 | 2A-9002039 |
| 2,6-Diamino-4,5,6,7-tetrahydrobenzothiazole | 104617-49-4 | 2A-9002040 |
| 2,6-Diaminopyridine | 141-86-6 | 2A-9002041 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA