
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 5676-58-4 |
| Catalog No. | 2A-9002027 |
| Chinese Name | 2,5-二甲基苯并恶唑 |
| Synonyms | 2,5-dimethyl-1,3-benzoxazole; EINECS 227-136-5; MFCD00005773 |
| Molecular Formula | C9H9NO |
| Molecular Weight | 147.17400 |
| Purity | 98 |
| Density | 1.09 g/mL at 25 °C(lit.) |
| Boiling Point | 218-219 °C(lit.) |
| Appearance | brown transparent liquid |
| Storage Condition | Keep away from light, cool and dry place, sealed a |
| HTC | 2934999090 |
| SMILES | Cc1ccc2oc(C)nc2c1 |
| InChI | InChI=1S/C9H9NO/c1-6-3-4-9-8(5-6)10-7(2)11-9/h3-5H,1-2H3 |
| InChI Key | XVQGFGKAPKEUFT-UHFFFAOYSA-N |
| MSDS | msds/2027_1_5676_58_4.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Purity: 97.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 2,5-Dichloropyridine | 16110-09-1 | 2A-9001979 |
| 2,5-Diiodothiophene | 625-88-7 | 2A-9002011 |
| 2,5-Dimethyl-1-(2-thienylmethyl)pyrrole-3-carboxylic acid | 306936-14-1 | 2A-9002022 |
| 2,5-Dimethyl-1-[4-(trifluoromethyl)phenyl]pyrrole | 570-05-8 | 2A-9002024 |
| 2,5-Dimethyl-4-(2-thienylaminosulphonyl)furan-3-carboxylic acid | 306936-40-3 | 2A-9002025 |
| 2,5-Dimethylthiazole | 4175-66-0 | 2A-9002029 |
| 2,5-Dimethylthiophene | 638-02-8 | 2A-9002030 |
| 2,6-Bis(trifluoromethyl)-4-hydroxyquinoline | 35877-04-4 | 2A-9002035 |
| 2,6-Bis(trifluoromethyl)pyridine | 455-00-5 | 2A-9002037 |
| 2,6-Di(oxiran-2-ylmethyl)-1,2,3,5,6,7-hexahydropyrrolo[3,4-f]isoindole-1,3,5,7-tetraone | 23328-66-7 | 2A-9002038 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA