
CAS Number475-80-9
Synonyms6-Nitrophenanthro[3,4-d][1,3]dioxole-5-carboxylic acid; 6-nitronaphtho[2,1-g][1,3]benzodioxole-5-carboxylic acid; Aristolochic Acid B; Aristolochic acid II
Molecular FormulaC16H9NO6
Molecular Weight311.246
Density1.6±0.1 g/cm3
Boiling Point592.2±50.0 °C at 760 mmHg
Melting Point270-272℃
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 475-80-9 |
| Catalog No. | 2A-0202577 |
| Chinese Name | 马兜铃酸 B |
| Synonyms | 6-Nitrophenanthro[3,4-d][1,3]dioxole-5-carboxylic acid; 6-nitronaphtho[2,1-g][1,3]benzodioxole-5-carboxylic acid; Aristolochic Acid B; Aristolochic acid II |
| Molecular Formula | C16H9NO6 |
| Molecular Weight | 311.246 |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 592.2±50.0 °C at 760 mmHg |
| Melting Point | 270-272℃ |
| Storage Condition | room temperature |
| Packaging | III |
| Application | Aristolochic acid B is one of the main components of aristolochic acid (AA), a natural product from the taxon Aristolochiaceae. Aristolochic acid is known to be a potent mutagen and carcinogen. Aristo |
| SMILES | O=C(O)c1cc2c(c3c1c([N+](=O)[O-])cc1ccccc13)OCO2 |
| InChI | InChI=1S/C16H9NO6/c18-16(19)10-6-12-15(23-7-22-12)14-9-4-2-1-3-8(9)5-11(13(10)14)17(20)21/h1-6H,7H2,(H,18,19) |
| InChI Key | MEEXETVZNQYRSP-UHFFFAOYSA-N |
| Hazard Symbols | 6.1(b) |
| Transport Info | Product name: Aristolochic acid II |
| Related Products in Alkaloids | ||
|---|---|---|
| 7-ACETYLLYCOPSAMINE | 74243-01-9 | 2A-0202569 |
| 7-O-Acetylintermedine N-oxide | 6815132-59-6 | 2A-0202570 |
| 7-acetyllycopsamine | 73544-48-6 | 2A-0202571 |
| 7-Acetyllycopsamine N-oxide | 685132-58-5 | 2A-0202572 |
| Aristolochic acid sodium salt | 10190-99-5 | 2A-0202576 |
| Aristolochic acid D | 17413-38-6 | 2A-0202578 |
| Castalagin | 24312-00-3 | 2A-0202579 |
| Chebulinic acid | 18942-26-2 | 2A-0202584 |
| CYANIDIN 3-ARABINOSIDE | 57186-11-5 | 2A-0202590 |
| CYANIDIN-3-GALACTOSIDE CHLORIDE | 27661-36-5 | 2A-0202592 |
| Browse all Alkaloids products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA