
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 10190-99-5 |
| Catalog No. | 2A-0202576 |
| Chinese Name | 马兜铃酸I 钠盐 |
| Synonyms | EINECS 233-463-4; sodium,8-methoxy-6-nitronaphtho[2,1-g][1,3]benzodioxole-5-carboxylate |
| Molecular Formula | C17H10NNaO7 |
| Molecular Weight | 363.254 |
| Boiling Point | 615.5ºC at 760 mmHg |
| Appearance | powder |
| Water Solubility | H2O: 50 mg/mL |
| Storage Condition | Seal in a cool, dry place. |
| Packaging | III |
| Application | Aristolochic acid sodium salt (Aristolochic acid sodium 1) is a component of some Chinese herbal medicines and is responsible for nephrotoxicity. It is a prodrug that is activated by reduction of the |
| SMILES | COc1cccc2c1cc([N+](=O)[O-])c1c(C(=O)[O-])cc3c(c12)OCO3.[Na+] |
| InChI | InChI=1S/C17H11NO7.Na/c1-23-12-4-2-3-8-9(12)5-11(18(21)22)14-10(17(19)20)6-13-16(15(8)14)25-7-24-13;/h2-6H,7H2,1H3,(H,19,20);/q;+1/p-1 |
| InChI Key | BQVOPWJSBBMGBR-UHFFFAOYSA-M |
| Hazard Symbols | 6.1(b) |
| Transport Info | Product name: Aristolochic acid sodium salt |
| Related Products in Alkaloids | ||
|---|---|---|
| 3-O-Acetyl 9,11-dehydro-boswellic acid | 122651-20-1 | 2A-0202567 |
| 7-ACETYLLYCOPSAMINE | 74243-01-9 | 2A-0202569 |
| 7-O-Acetylintermedine N-oxide | 6815132-59-6 | 2A-0202570 |
| 7-acetyllycopsamine | 73544-48-6 | 2A-0202571 |
| 7-Acetyllycopsamine N-oxide | 685132-58-5 | 2A-0202572 |
| Aristolochic acid II | 475-80-9 | 2A-0202577 |
| Aristolochic acid D | 17413-38-6 | 2A-0202578 |
| Castalagin | 24312-00-3 | 2A-0202579 |
| Chebulinic acid | 18942-26-2 | 2A-0202584 |
| CYANIDIN 3-ARABINOSIDE | 57186-11-5 | 2A-0202590 |
| Browse all Alkaloids products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA