
CAS Number102438-99-3
Synonyms2,4,6-trimethoxyanilinium chloride; 2,4,6-trimethoxyphenylamine,chloride; trimethoxyanilinehydrochloride; trimethoxy aniline monohydrochloride; 2,4,6-trimethoxyaniline hydrochloride; 2,3-DIMERCAPTO-1-PROPANESULFONIC ACID,SODIUM SALT MONOHYDRATE
Molecular FormulaC9H14O3N1Cl1
Molecular Weight219.67
Density1.118g/cm3
Boiling Point306.9ºC at 760mmHg
Melting Point220-225ºC
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 102438-99-3 |
| Catalog No. | 2A-0200441 |
| Chinese Name | 2,4,6-三甲氧基苯胺盐酸盐 |
| Synonyms | 2,4,6-trimethoxyanilinium chloride; 2,4,6-trimethoxyphenylamine,chloride; trimethoxyanilinehydrochloride; trimethoxy aniline monohydrochloride; 2,4,6-trimethoxyaniline hydrochloride; 2,3-DIMERCAPTO-1-PROPANESULFONIC ACID,SODIUM SALT MONOHYDRATE |
| Molecular Formula | C9H14O3N1Cl1 |
| Molecular Weight | 219.67 |
| Density | 1.118g/cm3 |
| Boiling Point | 306.9ºC at 760mmHg |
| Melting Point | 220-225ºC |
| Storage Condition | room temperature |
| HTC | 2922299090 |
| MDL Number | MFCD00211326 |
| SMILES | COc1cc(OC)c(N)c(OC)c1.Cl |
| InChI | InChI=1S/C9H13NO3/c1-11-6-4-7(12-2)9(10)8(5-6)13-3/h4-5H,10H2,1-3H3 |
| InChI Key | GRHAUEFIQOUKAY-UHFFFAOYSA-N |
| MSDS | msds/202353_1_102438_99_3.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Naphthalenol, 4-bromo-5-chloro- | 2454397-73-8 | 2A-0200430 |
| 2-Bromo-3-fluoro-pyridin-4-ylamine | 1417638-80-2 | 2A-0200433 |
| (2-[2-(2-HYDROXY-ETHOXY)-ETHOXY]-ETHYL)-CARBAMIC ACID BENZYL ESTER | 205535-92-8 | 2A-0200433 |
| Methyl 2-BroMo-3-fluoroisonicotinate | 1214385-66-6 | 2A-0200435 |
| 6-broMo-1-Methyl-1H-benzo[d]iMidazol-2(3H)-one | 305790-48-1 | 2A-0200438 |
| Methyl 4,6-dichloro-2-methylnicotinate | 1196073-28-5 | 2A-0200442 |
| tert-Butyl 3-(2-hydroxyethoxy)propanoate | 671802-00-9 | 2A-0200442 |
| 4-broMo-6-chloro-2-Methylpyridazin-3(2h)-one | 1178884-53-1 | 2A-0200638 |
| Methyl 4-bromo-2,3-difluorobenzoate | 1807244-07-0 | 2A-0200445 |
| 2-diethoxyphosphoryl-N,N-dimethylacetamide | 3842-86-2 | 2A-0200446 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA