
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 2391-56-2 |
| Catalog No. | 2A-1199509 |
| Chinese Name | 4,4'-(1,5-戊二氧基)二苯胺 |
| Synonyms | 4,4'-pentanediyldioxy-di-aniline; 4,4'-Pentandiyldioxy-di-anilin |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.377 |
| Density | 1.177g/cm3 |
| Boiling Point | 510.1ºC at 760mmHg |
| Appearance | solid |
| Storage Condition | Room temperature, protected from light, inert gas |
| HTC | 2922299090 |
| MDL Number | MFCD01632139 |
| SMILES | Nc1ccc(OCCCCCOc2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C17H22N2O2.2ClH/c18-14-4-8-16(9-5-14)20-12-2-1-3-13-21-17-10-6-15(19)7-11-17;;/h4-11H,1-3,12-13,18-19H2;2*1H |
| InChI Key | SLHXQWDUYXSTPA-UHFFFAOYSA-N |
| MSDS | msds/201489_1_2391_56_2.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Tall oil rosins | 8052-10-6 | 2A-1199499 |
| 8-P-MENTHYL HYDROPEROXIDE | 80-47-7 | 2A-1199500 |
| 3,5-diamino-N-(pyridin-3-ylmethyl)benzamide | 1174642-69-3 | 2A-1199501 |
| Ethanone, 2,2-dibromo-1-(4-methoxyphenyl)- | 13664-92-1 | 2A-1199502 |
| POLYSULFONE | 25135-51-7 | 2A-1199504 |
| 4-(Octadecyloxy)-1,3-benzenediamine | 155096-60-9 | 2A-1199511 |
| 3,4-Dichloroacetophenone | 2642-63-8 | 2A-2199514 |
| 3,4'-Dihydroxyflavone | 14919-49-4 | 2A-2199515 |
| Aquafone P;SPPSU | 2A-1199516 | 2A-1199516 |
| Sulfonated Polyethersulfone | 2A-1199517 | 2A-1199517 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA