
CAS Number21854-95-5
SynonymsBenzil,2'-dichloro; 2,2'-Dichlor-benzil; Benzil,2,2'-dichloro; MFCD00018263; 2,2'-dichlorobenzyl; 2,2'-Dichlorodibenzoyl; 2,2'-DIADAMANTYLAMINE HYDROCHLORIDE; 2,2′-Dichlorobenzil; 2,2'-Dichlorobenzil
Molecular FormulaClC6H4COCOC6H4Cl
Molecular Weight279.12
Purity97%
Density1.366g/cm3
Boiling Point426.9ºC at 760 mmHg
Melting Point132-136 °C (lit.)
Appearancesolid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 21854-95-5 |
| Catalog No. | 2A-1199343 |
| Chinese Name | 2,2'-二氯联苯甲酰 |
| Synonyms | Benzil,2'-dichloro; 2,2'-Dichlor-benzil; Benzil,2,2'-dichloro; MFCD00018263; 2,2'-dichlorobenzyl; 2,2'-Dichlorodibenzoyl; 2,2'-DIADAMANTYLAMINE HYDROCHLORIDE; 2,2′-Dichlorobenzil; 2,2'-Dichlorobenzil |
| Molecular Formula | ClC6H4COCOC6H4Cl |
| Molecular Weight | 279.12 |
| Purity | 97 |
| Density | 1.366g/cm3 |
| Boiling Point | 426.9ºC at 760 mmHg |
| Melting Point | 132-136 °C (lit.) |
| Appearance | solid |
| Storage Condition | Place in a tight container and store in a cool, dr |
| HTC | 2914700090 |
| PubChem ID | 24882282 |
| MDL Number | MFCD00018263 |
| SMILES | Clc1ccccc1C(=O)C(=O)c2ccccc2Cl |
| InChI | 1S/C14H8Cl2O2/c15-11-7-3-1-5-9(11)13(17)14(18)10-6-2-4-8-12(10)16/h1-8H |
| InChI Key | VOSNNSVWVJFJCR-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| MSDS | msds/201316_1_21854_95_5.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| BLUE 203 | 98660-18-5 | 2A-1199337 |
| 2,2'-DIHYDROXYBENZOPHENONE | 835-11-0 | 2A-1199339 |
| Butane, 1,1-dibutoxy- | 5921-80-2 | 2A-1199340 |
| TRIALLYL PHOSPHATE | 1623-19-4 | 2A-1199341 |
| 1,3-DI-TERT-BUTYLBENZENE | 1014-60-4 | 2A-1199342 |
| 9-(2-Bromphenyl)-phenanthren | 3582-48-7 | 2A-1199346 |
| 2-BROMOPHENYLDIPHENYLPHOSPHINE | 62336-24-7 | 2A-1199347 |
| ACETIC ACID 3-BUTEN-2-YL ESTER | 6737-11-7 | 2A-1199348 |
| N-TERT-BUTYLISOPROPYLAMINE | 7515-80-2 | 2A-1199349 |
| Diethyl 3-Nitrobenzylphosphonate | 104097-04-3 | 2A-1199353 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA