
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1014-60-4 |
| Catalog No. | 2A-1199342 |
| Chinese Name | 1,3-二叔丁基苯 |
| Synonyms | 1,3-ditert-butylbenzene; MFCD00008830 |
| Molecular Formula | C6H4[C(CH3)3]2 |
| Molecular Weight | 190.32 |
| Purity | 97 |
| Density | 0.859 g/mL at 25 °C(lit.) |
| Boiling Point | 106-107 °C/18 mmHg (lit.) |
| Melting Point | 10-11 °C (lit.) |
| Appearance | liquid |
| Storage Condition | Keep container sealed and store in a cool, dry pla |
| PubChem ID | 24856451 |
| MDL Number | MFCD00008830 |
| SMILES | CC(C)(C)c1cccc(c1)C(C)(C)C |
| InChI | 1S/C14H22/c1-13(2,3)11-8-7-9-12(10-11)14(4,5)6/h7-10H,1-6H3 |
| InChI Key | ILNDSSCEZZFNGE-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| MSDS | msds/201315_1_1014_60_4.pdf |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 6'-(DIETHYLAMINO)-1',3'-DIMETHYLFLUORAN | 21934-68-9 | 2A-1199336 |
| BLUE 203 | 98660-18-5 | 2A-1199337 |
| 2,2'-DIHYDROXYBENZOPHENONE | 835-11-0 | 2A-1199339 |
| Butane, 1,1-dibutoxy- | 5921-80-2 | 2A-1199340 |
| TRIALLYL PHOSPHATE | 1623-19-4 | 2A-1199341 |
| 2,2'-DICHLOROBENZIL | 21854-95-5 | 2A-1199343 |
| 9-(2-Bromphenyl)-phenanthren | 3582-48-7 | 2A-1199346 |
| 2-BROMOPHENYLDIPHENYLPHOSPHINE | 62336-24-7 | 2A-1199347 |
| ACETIC ACID 3-BUTEN-2-YL ESTER | 6737-11-7 | 2A-1199348 |
| N-TERT-BUTYLISOPROPYLAMINE | 7515-80-2 | 2A-1199349 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA