
CAS Number16066-09-4
Synonyms1,1,1,3,5,7,7,7-Octamethyltetrasiloxane; Tetrasiloxane, 1,1,1,3,5,7,7,7-octamethyl-,; MFCD00053664; 1,3-BIS(TRIMETHYLSILOXY)-1,3-DIMETHYLDISILOXANE; EINECS 240-209-6
Molecular FormulaC8H26O3Si4
Molecular Weight282.63
Density0.863
Boiling Point205.1±23.0 °C at 760 mmHg
Melting Point<0ºC
AppearanceLiquid;Colorless to Almost colorless clear liquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 16066-09-4 |
| Catalog No. | 2A-1198553 |
| Chinese Name | 1,1,1,3,5,7,7,7-八甲基四硅氧烷 |
| Synonyms | 1,1,1,3,5,7,7,7-Octamethyltetrasiloxane; Tetrasiloxane, 1,1,1,3,5,7,7,7-octamethyl-,; MFCD00053664; 1,3-BIS(TRIMETHYLSILOXY)-1,3-DIMETHYLDISILOXANE; EINECS 240-209-6 |
| Molecular Formula | C8H26O3Si4 |
| Molecular Weight | 282.63 |
| Density | 0.863 |
| Boiling Point | 205.1±23.0 °C at 760 mmHg |
| Melting Point | <0ºC |
| Appearance | Liquid;Colorless to Almost colorless clear liquid |
| Storage Condition | Store under inert gas; avoid moisture (decompositi |
| HTC | 2942000000 |
| MDL Number | MFCD00053664 |
| SMILES | C[Si](O[Si](C)O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C8H24O3Si4/c1-12(10-14(3,4)5)9-13(2)11-15(6,7)8/h1-8H3 |
| InChI Key | OHSYWAVRSCQMHG-UHFFFAOYSA-N |
| MSDS | msds/200466_1_16066_09_4.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Purity: 95.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Benzene, 1,3,5-tribromo-2,4,6-triethynyl- | 2546258-63-1 | 2A-1198546 |
| Tetraphenyltetrabenzoporphyrin | 80528-89-8 | 2A-1198548 |
| vitamin B complex | 2A-1198550 | 2A-1198550 |
| 2,3,4-TRICHLORONITROBENZENE | 17700-09-3 | 2A-1198551 |
| Tetraphenylsilane | 1048-08-4 | 2A-1198552 |
| N-(2-HYDROXYETHYL)SUCCINIMIDE | 18190-44-8 | 2A-2198554 |
| 2-Ethoxybenzamidine hydrochloride | 18607-00-8 | 2A-2198556 |
| 3,6-Dimethylpyrocatechol | 2785-78-6 | 2A-2198557 |
| Alanine, N,3-bis[(1,1-dimethylethoxy)carbonyl]-L-histidyl-2-methyl- | 1169630-98-1 | 2A-2198558 |
| 1,1-[4-(Ethylamino)-6-hydroxy-5-propyl-1,3-phenylene]bis-ethanone | 79324-51-9 | 2A-2198559 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA