
CAS Number17700-09-3
Synonyms4-nitro-1,2,3-trichlorobenze; 2,3,4-Trichloro-1-nitrobenzene; 1-NITRO-2,3,4-TRICHLOROBENZENE; nitro-trichlorobenzene; 4-Nitro-1,2,3-trichlorobenzene; 4-nitro-1,2,3-trichloro-benzen; 1,2,3-Trichloronitrobenzene; MFCD00007063; 2,3,4-trichloro-nitrobenzene; EINECS 241-705-5; 1,2,3-Trichloro-4-nitrobenzene; trichloronitrobenzene
Molecular FormulaC6H2Cl3NO2
Molecular Weight226.445
Density1.7±0.1 g/cm3
Boiling Point296.2±35.0 °C at 760 mmHg
Melting Point53-56 °C(lit.)
AppearanceWhite to light yellow crystal powder
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 17700-09-3 |
| Catalog No. | 2A-1198551 |
| Chinese Name | 2,3,4-三氯硝基苯 |
| Synonyms | 4-nitro-1,2,3-trichlorobenze; 2,3,4-Trichloro-1-nitrobenzene; 1-NITRO-2,3,4-TRICHLOROBENZENE; nitro-trichlorobenzene; 4-Nitro-1,2,3-trichlorobenzene; 4-nitro-1,2,3-trichloro-benzen; 1,2,3-Trichloronitrobenzene; MFCD00007063; 2,3,4-trichloro-nitrobenzene; EINECS 241-705-5; 1,2,3-Trichloro-4-nitrobenzene; trichloronitrobenzene |
| Molecular Formula | C6H2Cl3NO2 |
| Molecular Weight | 226.445 |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 296.2±35.0 °C at 760 mmHg |
| Melting Point | 53-56 °C(lit.) |
| Appearance | White to light yellow crystal powder |
| Storage Condition | Sealed at room temperature, protected from light, |
| Packaging | III |
| HTC | 2904909090 |
| SMILES | O=[N+]([O-])c1ccc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C6H2Cl3NO2/c7-3-1-2-4(10(11)12)6(9)5(3)8/h1-2H |
| InChI Key | BGKIECJVXXHLDP-UHFFFAOYSA-N |
| Hazard Symbols | 6.1 |
| MSDS | msds/200464_2_17700_09_3.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 96.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-((4-(4-cyclopropylnaphthalen-1-yl)-5-hydroxy-4H-1,2,4-triazol-3-yl)thio)aceticacid | 1384208-36-9 | 2A-2198543 |
| ethyl 2-((5-bromo-4-(4- cyclopropylnaphthalen-1-yl)-4H-1,2,4-triazol-3-yl)thio)acetate | 1158970-52-5 | 2A-2198544 |
| Benzene, 1,3,5-tribromo-2,4,6-triethynyl- | 2546258-63-1 | 2A-1198546 |
| Tetraphenyltetrabenzoporphyrin | 80528-89-8 | 2A-1198548 |
| vitamin B complex | 2A-1198550 | 2A-1198550 |
| Tetraphenylsilane | 1048-08-4 | 2A-1198552 |
| 1,3-BIS(TRIMETHYLSILOXY)-1,3-DIMETHYLDISILOXANE | 16066-09-4 | 2A-1198553 |
| N-(2-HYDROXYETHYL)SUCCINIMIDE | 18190-44-8 | 2A-2198554 |
| 2-Ethoxybenzamidine hydrochloride | 18607-00-8 | 2A-2198556 |
| 3,6-Dimethylpyrocatechol | 2785-78-6 | 2A-2198557 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA