CAS Number248603-11-4
Synonyms2-(2-bromo-2-methyl-propionyloxy)-ethyl 2-bromoisobutyrate; 1,2-Bis(2'-bromoisobutyryloxy)ethane; 1,2-Bis(2 inverted exclamation marka-bromoisobutyryloxy)ethane; Ethane-1,2-diyl bis(2-bromo-2-methylpropanoate); ethylene glycol di(2-bromoisobutyrate); 2f-BiB; Difunctional initiator; 1,2-bis(2-bromoisobutyryloxy)ethane; ETHYLENE BIS(2-BROMOISOBUTYRATE); ethylene glycol bis(2-bromoisobutyrate)
Molecular FormulaC10H16Br2O4
Molecular Weight360.04
Purity97%
Melting Point45-49 °C
Appearancesolid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 248603-11-4 |
| Catalog No. | 2A-1197901 |
| Chinese Name | 二溴代异丁酸乙二醇酯 |
| Synonyms | 2-(2-bromo-2-methyl-propionyloxy)-ethyl 2-bromoisobutyrate; 1,2-Bis(2'-bromoisobutyryloxy)ethane; 1,2-Bis(2 inverted exclamation marka-bromoisobutyryloxy)ethane; Ethane-1,2-diyl bis(2-bromo-2-methylpropanoate); ethylene glycol di(2-bromoisobutyrate); 2f-BiB; Difunctional initiator; 1,2-bis(2-bromoisobutyryloxy)ethane; ETHYLENE BIS(2-BROMOISOBUTYRATE); ethylene glycol bis(2-bromoisobutyrate) |
| Molecular Formula | C10H16Br2O4 |
| Molecular Weight | 360.04 |
| Purity | 97 |
| Melting Point | 45-49 °C |
| Appearance | solid |
| Storage Condition | room temperature |
| HTC | 2915900090 |
| PubChem ID | 329763983 |
| MDL Number | MFCD16621492 |
| SMILES | CC(C)(Br)C(=O)OCCOC(=O)C(C)(C)Br |
| InChI | 1S/C10H16Br2O4/c1-9(2,11)7(13)15-5-6-16-8(14)10(3,4)12/h5-6H2,1-4H3 |
| InChI Key | ZPBJLEZUJMQIHC-UHFFFAOYSA-N |
| NACRES Code | NA.23 |
| UNSPSC | 12162002 |
| MSDS | msds/199764_1_248603_11_4.pdf |
| Tax Rebate | 9.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Imported food hygiene supervision and inspection S. Export food hygiene supervision and inspection M. Imported commodity inspection N. Exported commodity inspection |
| Transport Info | Product name: Supervision conditions A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| N-(2-CHLOROBENZYLIDENE)-4-FLUOROANILINE | 75020-01-8 | 2A-1197888 |
| 1-BROMO-2-(METHOXYMETHOXY)ETHANE | 112496-94-3 | 2A-1197889 |
| N N-DI-N-HEXYLANILINE | 4430-09-5 | 2A-1197892 |
| 3-DIBUTYLAMINO-1-PROPYNE | 6336-58-9 | 2A-1197894 |
| 1,4-CHRYSENEQUINONE | 100900-16-1 | 2A-1197898 |
| Benzoic acid (trifluoromethanesulfonic acid)anhydride | 36967-85-8 | 2A-1197902 |
| AMYL METHYL SULFIDE | 1741-83-9 | 2A-1197903 |
| 4-CYANO-TEMPO | 38078-71-6 | 2A-1197904 |
| IS 741 | 141283-87-6 | 2A-1197905 |
| 6-broMo-3,3-diMethylindolin-2-one | 158326-84-2 | 2A-1197906 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS