CAS Number10375-34-5
Synonyms2,5-Furandicarboxylic acid chloride; Furan-2,5-dicarboxylic acid dichloride; furan-2,5-dicarbonyl dichloride; 2,5-FURANDICARBONYLDICHLORIDE; Furan-2,5-dicarbonsaurechlorid; furan-2,5-dicarboxyl chloride; dichloroanhydride of 2,5-furandicarboxylic acid; 2,5-furandicarboxylic acid dichloride; 2,5-furandicarbonyl chloride
Molecular FormulaC6H2O3Cl2
Molecular Weight192.99
Boiling Point245°C(lit.)
Melting Point78°C
AppearanceWhite-off-white crystal-powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 10375-34-5 |
| Catalog No. | 2A-1195408 |
| Chinese Name | 2,5-呋喃二甲酰氯 |
| Synonyms | 2,5-Furandicarboxylic acid chloride; Furan-2,5-dicarboxylic acid dichloride; furan-2,5-dicarbonyl dichloride; 2,5-FURANDICARBONYLDICHLORIDE; Furan-2,5-dicarbonsaurechlorid; furan-2,5-dicarboxyl chloride; dichloroanhydride of 2,5-furandicarboxylic acid; 2,5-furandicarboxylic acid dichloride; 2,5-furandicarbonyl chloride |
| Molecular Formula | C6H2O3Cl2 |
| Molecular Weight | 192.99 |
| Boiling Point | 245°C(lit.) |
| Melting Point | 78°C |
| Appearance | White-off-white crystal-powder |
| Storage Condition | 2-8°C |
| HTC | 2932190090 |
| PubChem ID | 16582083 |
| MDL Number | MFCD28044847 |
| SMILES | O=C(Cl)c1ccc(C(=O)Cl)o1 |
| InChI | InChI=1S/C6H2Cl2O3/c7-5(9)3-1-2-4(11-3)6(8)10/h1-2H |
| InChI Key | PDSULNVJASBMLP-UHFFFAOYSA-N |
| MSDS | msds/197106_1_10375_34_5.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| N-(5-tert-Butylisoxazol-3-yl)-N'-{4-[7-(2-morpholin-4-ylethoxy)imidazo[2,1-b][1,3]benzothiazol-2-yl]phenyl}urea | 950769-58-1 | 2A-2195381 |
| 3-(1H-Indol-3-yl)-4-[2-(4-methylpiperazin-1-yl)quinazolin-4-yl]pyrrole-2,5-dione | 425637-18-9 | 2A-2195385 |
| 2,5-Bis(aminomethyl)tetrahydrofuran | 66918-21-6 | 2A-1195405 |
| 2-Furanmethanol, 5,5'-[oxybis(methylene)]bis- | 54044-27-8 | 2A-1195406 |
| 2-Furancarboxylic acid, 5,5'-[oxybis(methylene)]bis- | 76154-25-1 | 2A-1195407 |
| 2,5-Furandicarboxamide(9CI) | 124052-68-2 | 2A-1195409 |
| Tetrahydro-2,5-furandicarboxylic acid dimethyl ester | 10260-41-0 | 2A-1195410 |
| 1H-Benzimidazole,2-(ethylthio)-(9CI) | 14610-11-8 | 2A-2195432 |
| 3-Amino-5-methyl-1,2,4-thiadiazole | 27182-55-4 | 2A-1195434 |
| 1H-Pyrazole-1-carboxamide, 4,5-dimethyl- | 15754-64-0 | 2A-1195439 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS