
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 76149-14-9 |
| Catalog No. | 2A-1193909 |
| Chinese Name | 4-碘苯-1,2-二醇 |
| Synonyms | 4-Jod-brenzcatechin; 4-iodo-pyrocatechol; 4-iodo-2-hydroxyphenol; 4-iodo-1,2-benzenediol; 3,4-dihydroxy-iodobenzene; 4-Jod-1.2-dihydroxy-benzol |
| Molecular Formula | C6H5O2I1 |
| Molecular Weight | 236.01 |
| Storage Condition | room temperature |
| HTC | 2908199090 |
| PubChem ID | 131539834 |
| MDL Number | MFCD11521304 |
| SMILES | Oc1ccc(I)cc1O |
| InChI | InChI=1S/C6H5IO2/c7-4-1-2-5(8)6(9)3-4/h1-3,8-9H |
| InChI Key | GEQUYGQAOAAGGO-UHFFFAOYSA-N |
| MSDS | msds/195518_1_76149_14_9.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2908199090. Derivatives of polyphenols or phenol-alcohols containing only halogen substituents and their salts. VAT:17.0%. tax rebate rate:9.0%. supervision conditions:None. MFN tariff:5.5%. general tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Carbamic acid, N-(4-fluoro-3-formylphenyl)-, 1,1-dimethylethyl ester | 1785327-02-7 | 2A-1193904 |
| 3-METHYLCROTONONITRILE | 4786-24-7 | 2A-1193905 |
| 8-CHLORO-3,4-DIHYDRO-1H-BENZO[E][1,4]DIAZEPINE-2,5-DIONE | 195983-60-9 | 2A-1193906 |
| 262-NP, 4-(1,1,5-Trimethylhexyl)phenol | 521947-27-3 | 2A-1193907 |
| 4(1H)-Pyridinone, 2,3-dihydro- | 24681-60-5 | 2A-1193908 |
| 4-(2-phenyl-5,6-dihydro-1,4-oxathiin-3-yl)-N,N-ditetradecylaniline | 192937-52-3 | 2A-1193910 |
| N-(4-aminobenzoyl)- D-Glutamic acid | 5959-18-2 | 2A-1193911 |
| 9-(Z)-Tetradecen-1-ol acetate | 16725-53-4 | 2A-1193912 |
| helichrysetin | 62014-87-3 | 2A-1193914 |
| 1,2-Bis(dicyclohexylphosphino)ethane bis(tetrafluoroborate) | 1779389-90-9 | 2A-2193915 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA