CAS Number123-68-2
SynonymsEINECS 204-642-4; hexanoic acid allyl ester; hexanoic acid prop-2-enyl ester; Hexanoic acid, allyl ester; 2-Propenyl n-hexanoate; Hexanoic acid, 2-propen-1-yl ester; prop-2-enyl hexanoate; MFCD00038339; 2-propenyl hexanoate; Allyl n-caproate; Hexanoic acid, 2-propenyl ester; Allyl n-hexanoate; UNII-3VH84A363D; Allyl hexanoate; Allyl caproate; prop-2-en-1-yl hexanoate
Molecular FormulaCH3(CH2)4CO2CH2CH=CH2
Molecular Weight156.22
Purity≥98%
Density0.9±0.1 g/cm3
Boiling Point75-76 °C/15 mmHg (lit.)
AppearanceTransparent colorless liquid
EINECS204-642-4
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 123-68-2 |
| Catalog No. | 2A-9019524 |
| Chinese Name | 己酸丙烯酯 |
| Synonyms | EINECS 204-642-4; hexanoic acid allyl ester; hexanoic acid prop-2-enyl ester; Hexanoic acid, allyl ester; 2-Propenyl n-hexanoate; Hexanoic acid, 2-propen-1-yl ester; prop-2-enyl hexanoate; MFCD00038339; 2-propenyl hexanoate; Allyl n-caproate; Hexanoic acid, 2-propenyl ester; Allyl n-hexanoate; UNII-3VH84A363D; Allyl hexanoate; Allyl caproate; prop-2-en-1-yl hexanoate |
| Molecular Formula | CH3(CH2)4CO2CH2CH=CH2 |
| Molecular Weight | 156.22 |
| Purity | ≥98 |
| Density | 0.9±0.1 g/cm3 |
| Boiling Point | 75-76 °C/15 mmHg (lit.) |
| Appearance | Transparent colorless liquid |
| Water Solubility | PRACTICALLY INSOLUBLE |
| Storage Condition | Packed in aluminum drum or plastic drum. Store and |
| Packaging | III |
| EINECS | 204-642-4 |
| HTC | 29159080 |
| PubChem ID | 24900808 |
| MDL Number | MFCD00038339 |
| SMILES | CCCCCC(=O)OCC=C |
| InChI | 1S/C9H16O2/c1-3-5-6-7-9(10)11-8-4-2/h4H,2-3,5-8H2,1H3 |
| InChI Key | RCSBILYQLVXLJG-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12164502 |
| Hazard Symbols | 6.1(b) |
| MSDS | msds/19524_1_123_68_2.pdf |
| Tax Rebate | 9.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Imported food hygiene supervision and inspection S. Export food hygiene supervision and inspection M. Imported commodity inspection N. Exported commodity inspection |
| Transport Info | Product name: Chemical name |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Choline hydroxide | 123-41-1 | 2A-9019513 |
| Girard's Reagent T | 123-46-6 | 2A-9019515 |
| Succinimide | 123-56-8 | 2A-9019519 |
| Propionic anhydride | 123-62-6 | 2A-9019520 |
| N,N'-Dimethyl-N,N'-bis(3-methylaminopropyl)trimethylenediamine | 123-67-1 | 2A-9019523 |
| Oxacycloheptadec-8-en-2-one | 123-69-3 | 2A-9019525 |
| N,N-Bis[3-(methylamino)propyl]methylamine | 123-70-6 | 2A-9019526 |
| Azodicarbonamide | 123-77-3 | 2A-9020495 |
| Dioctyl adipate | 123-79-5 | 2A-9020496 |
| Glycol dimercaptoacetate | 123-81-9 | 2A-9020497 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS