
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1496997-41-1 |
| Catalog No. | 2A-1191898 |
| Chinese Name | Thalidomide-5,6-F |
| Synonyms | MFCD32853274; 2-(2,6-Dioxo-3-piperidinyl)-5,6-difluoro-1H-isoindole-1,3(2H)-dione |
| Molecular Formula | C13H8O4N2F2 |
| Molecular Weight | 294.21 |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 534.6±50.0 °C at 760 mmHg |
| Appearance | solid |
| Storage Condition | 0-10°C; store in inert gas; avoid air, heat |
| Application | Thalidomide-5,6-F is a thalidomide-based enkephalin ligand used to supplement CRBN protein. Thalidomide-5,6-F can be linked to protein ligands through linkers to form PROTACs[1]. |
| PubChem ID | 151449864 |
| MDL Number | MFCD32853274 |
| SMILES | O=C1CCC(N2C(=O)c3cc(F)c(F)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C13H8F2N2O4/c14-7-3-5-6(4-8(7)15)13(21)17(12(5)20)9-1-2-10(18)16-11(9)19/h3-4,9H,1-2H2,(H,16,18,19) |
| InChI Key | AGHXYRKTAZEQQW-UHFFFAOYSA-N |
| Transport Info | Product name: 2-(2,6-dioxopiperidin-3-yl)-5,6-difluoroisoindoline-1,3-dione |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 4,6-dichloro-5-acetylpyrimidine | 60025-06-1 | 2A-1191885 |
| 3-(Trifluoromethyl)bicyclo[1.1.1]pentane-1-carboxylicacid | 224584-18-3 | 2A-1191891 |
| 2-chloro-4,5,7-trimethylquinoline | 329210-71-1 | 2A-1191892 |
| 3-methoxybicyclo[1.1.1]pentane-1-carboxylic acid | 156329-86-1 | 2A-1191893 |
| 3-Fluorobicyclo[1.1.1]pentane-1-carboxylicacid | 146038-53-1 | 2A-1191894 |
| 2-(2,6-dioxopiperidin-3-yl)-5-hydroxyisoindoline-1,3-dione | 64567-60-8 | 2A-1191899 |
| 2,5-bis(3-bromophenyl)-1,3,4-oxadiazole | 84832-73-5 | 2A-1191902 |
| 4-Pyridinecarboxamide, N,3-dihydroxy- | 89640-77-7 | 2A-1191907 |
| 3,5-DIBROMOTHIOPHENE-2-CARBALDEHYDE | 23688-07-5 | 2A-1191911 |
| Spiro[isobenzofuran-1(3H),9'-[9H]xanthen]-3-one, 3',6'-dihydroxy-5-mercapto- | 84461-60-9 | 2A-1191912 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA