CAS Number2905-54-6
Synonyms2,3-Dichlorobenzoic Methylester; methyl ester of 2,3-CBA; Methyl dichlorobenzoate; Benzoic acid,2,3-dichloro-,methyl ester; MFCD00061099; methyl-2,3-dichlorobenzoate; 2,3-Dichlorobenzoic acid methyl ester; Methyl 2,3-dichlorobenzoate; methyl ester of 2,3-dichlorobenzoic acid
Molecular FormulaC8H6Cl2O2
Molecular Weight205.04
Density1.355g/cm3
Boiling Point270ºC at 760 mmHg
Melting Point33-38ºC
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 2905-54-6 |
| Catalog No. | 2A-1191607 |
| Chinese Name | 2,3-二氯苯甲酸甲酯 |
| Synonyms | 2,3-Dichlorobenzoic Methylester; methyl ester of 2,3-CBA; Methyl dichlorobenzoate; Benzoic acid,2,3-dichloro-,methyl ester; MFCD00061099; methyl-2,3-dichlorobenzoate; 2,3-Dichlorobenzoic acid methyl ester; Methyl 2,3-dichlorobenzoate; methyl ester of 2,3-dichlorobenzoic acid |
| Molecular Formula | C8H6Cl2O2 |
| Molecular Weight | 205.04 |
| Density | 1.355g/cm3 |
| Boiling Point | 270ºC at 760 mmHg |
| Melting Point | 33-38ºC |
| Storage Condition | Store airtight in a cool, dry warehouse. |
| HTC | 2916399090 |
| PubChem ID | 3140186 |
| SMILES | COC(=O)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C8H6Cl2O2/c1-12-8(11)5-3-2-4-6(9)7(5)10/h2-4H,1H3 |
| InChI Key | RFVULUSGHFRDHJ-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Benzenamine, 4-benzo[b]thien-2-yl- | 54492-95-4 | 2A-1191600 |
| 1-IODO-2-PHENOXY-BENZENE | 34883-46-0 | 2A-1191602 |
| BIPHENYL-D10 | 1486-01-7 | 2A-1191603 |
| N1,N1'-(biphenyl-4,4'-diyl)bis(N1-phenyl-N4,N4-di-m-tolylbenzene-1,4-diamine) | 199121-98-7 | 2A-1191604 |
| 1,1'-Biphenyl, 2-bromo-4'-(1,1-dimethylethyl)- | 1033692-34-0 | 2A-1191605 |
| 4-CHLORO-1,1':2',1''-terphenyl | 21711-54-6 | 2A-1191608 |
| 4-BROMO-2,3,5,6-TETRAFLUOROBENZOTRIFLUORIDE | 17823-46-0 | 2A-1191609 |
| 1,2-DI-(4-N-BUTYLPHENYL)ACETYLENE | 80221-11-0 | 2A-1191611 |
| alpha-(o-Nitrophenyl)naphthalene | 5415-59-8 | 2A-1191612 |
| 2-(Naphthalen-1-yl)aniline | 92855-12-4 | 2A-1191613 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS